C31H33N5O3Si — CID 68754755
N-[(3E)-2-oxo-3-[[3-[(E)-2-pyridin-4-ylethenyl]-1-(2-trimethylsilylethoxymethyl)indazol-6-yl]methylidene]-1H-indol-7-yl]acetamide (PubChem CID 68754755) has the molecular formula C31H33N5O3Si and a molecular weight of 551.72 g/mol. Its IUPAC name is N-[(3E)-2-oxo-3-[[3-[(E)-2-pyridin-4-ylethenyl]-1-(2-trimethylsilylethoxymethyl)indazol-6-yl]methylidene]-1H-indol-7-yl]acetamide.
| Compound Name | N-[(3E)-2-oxo-3-[[3-[(E)-2-pyridin-4-ylethenyl]-1-(2-trimethylsilylethoxymethyl)indazol-6-yl]methylidene]-1H-indol-7-yl]acetamide |
|---|---|
| PubChem CID | 68754755 |
| Molecular Formula | C31H33N5O3Si |
| Molecular Weight | 551.72 g/mol |
| Exact Mass | 551.24 |
| IUPAC Name | N-[(3E)-2-oxo-3-[[3-[(E)-2-pyridin-4-ylethenyl]-1-(2-trimethylsilylethoxymethyl)indazol-6-yl]methylidene]-1H-indol-7-yl]acetamide |
| SMILES | CC(=O)Nc1cccc2c1NC(=O)/C2=C/c1ccc2c(/C=C/c3ccncc3)nn(COCC[Si](C)(C)C)c2c1 |
| InChI | InChI=1S/C31H33N5O3Si/c1-21(37)33-28-7-5-6-24-26(31(38)34-30(24)28)18-23-8-10-25-27(11-9-22-12-14-32-15-13-22)35-36(29(25)19-23)20-39-16-17-40(2,3)4/h5-15,18-19H,16-17,20H2,1-4H3,(H,33,37)(H,34,38)/b11-9+,26-18+ |
| InChIKey | JBSTYUYUQSOXCI-DNMGMROESA-N |
| XLogP | 6.37 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.72 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|