About (3S)-1-(4,4-difluorocyclohexanecarbonyl)piperidine-3-carboxylic acid
(3S)-1-(4,4-difluorocyclohexanecarbonyl)piperidine-3-carboxylic acid (PubChem CID 68755297) has the molecular formula C13H19F2NO3
and a molecular weight of 275.29 g/mol. Its IUPAC name is (3S)-1-(4,4-difluorocyclohexanecarbonyl)piperidine-3-carboxylic acid.
Molecular Properties
| Compound Name | (3S)-1-(4,4-difluorocyclohexanecarbonyl)piperidine-3-carboxylic acid |
| PubChem CID | 68755297 |
| Molecular Formula | C13H19F2NO3 |
| Molecular Weight | 275.29 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | (3S)-1-(4,4-difluorocyclohexanecarbonyl)piperidine-3-carboxylic acid |
| SMILES | O=C(O)[C@H]1CCCN(C(=O)C2CCC(F)(F)CC2)C1 |
| InChI | InChI=1S/C13H19F2NO3/c14-13(15)5-3-9(4-6-13)11(17)16-7-1-2-10(8-16)12(18)19/h9-10H,1-8H2,(H,18,19)/t10-/m0/s1 |
| InChIKey | YWIZZMSJBLRETA-JTQLQIEISA-N |
| XLogP | 2.14 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.29 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S)-1-(4,4-difluorocyclohexanecarbonyl)piperidine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-1-(4,4-difluorocyclohexanecarbonyl)piperidine-3-carboxylic acid?
The IUPAC name of (3S)-1-(4,4-difluorocyclohexanecarbonyl)piperidine-3-carboxylic acid (CID 68755297) is (3S)-1-(4,4-difluorocyclohexanecarbonyl)piperidine-3-carboxylic acid.
What is the SMILES notation for (3S)-1-(4,4-difluorocyclohexanecarbonyl)piperidine-3-carboxylic acid?
The canonical SMILES for (3S)-1-(4,4-difluorocyclohexanecarbonyl)piperidine-3-carboxylic acid is O=C(O)[C@H]1CCCN(C(=O)C2CCC(F)(F)CC2)C1.
What is the InChIKey of (3S)-1-(4,4-difluorocyclohexanecarbonyl)piperidine-3-carboxylic acid?
The InChIKey is YWIZZMSJBLRETA-JTQLQIEISA-N. The full InChI is InChI=1S/C13H19F2NO3/c14-13(15)5-3-9(4-6-13)11(17)16-7-1-2-10(8-16)12(18)19/h9-10H,1-8H2,(H,18,19)/t10-/m0/s1.
What are the key properties of (3S)-1-(4,4-difluorocyclohexanecarbonyl)piperidine-3-carboxylic acid?
(3S)-1-(4,4-difluorocyclohexanecarbonyl)piperidine-3-carboxylic acid has a molecular weight of 275.29 g/mol, XLogP of 2.14, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-1-(4,4-difluorocyclohexanecarbonyl)piperidine-3-carboxylic acid is sourced from PubChem (CID 68755297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).