C24H24Cl2N4O3 — CID 68755968
6-(4-chlorobenzoyl)-2-[3-(4-chlorophenyl)propylamino]-3-methoxy-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-one (PubChem CID 68755968) has the molecular formula C24H24Cl2N4O3 and a molecular weight of 487.39 g/mol. Its IUPAC name is 6-(4-chlorobenzoyl)-2-[3-(4-chlorophenyl)propylamino]-3-methoxy-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 6-(4-chlorobenzoyl)-2-[3-(4-chlorophenyl)propylamino]-3-methoxy-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 68755968 |
| Molecular Formula | C24H24Cl2N4O3 |
| Molecular Weight | 487.39 g/mol |
| Exact Mass | 486.12 |
| IUPAC Name | 6-(4-chlorobenzoyl)-2-[3-(4-chlorophenyl)propylamino]-3-methoxy-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-one |
| SMILES | COn1c(NCCCc2ccc(Cl)cc2)nc2c(c1=O)CN(C(=O)c1ccc(Cl)cc1)CC2 |
| InChI | InChI=1S/C24H24Cl2N4O3/c1-33-30-23(32)20-15-29(22(31)17-6-10-19(26)11-7-17)14-12-21(20)28-24(30)27-13-2-3-16-4-8-18(25)9-5-16/h4-11H,2-3,12-15H2,1H3,(H,27,28) |
| InChIKey | NLIPXNMBKUBYPK-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.39 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|