About spiro[3,4-dihydrochromene-2,4'-piperidine]-5-ol
spiro[3,4-dihydrochromene-2,4'-piperidine]-5-ol (PubChem CID 68756390) has the molecular formula C13H17NO2
and a molecular weight of 219.28 g/mol. Its IUPAC name is spiro[3,4-dihydrochromene-2,4'-piperidine]-5-ol.
Molecular Properties
| Compound Name | spiro[3,4-dihydrochromene-2,4'-piperidine]-5-ol |
| PubChem CID | 68756390 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | spiro[3,4-dihydrochromene-2,4'-piperidine]-5-ol |
| SMILES | Oc1cccc2c1CCC1(CCNCC1)O2 |
| InChI | InChI=1S/C13H17NO2/c15-11-2-1-3-12-10(11)4-5-13(16-12)6-8-14-9-7-13/h1-3,14-15H,4-9H2 |
| InChIKey | CABJQXZPCFHITC-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze spiro[3,4-dihydrochromene-2,4'-piperidine]-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[3,4-dihydrochromene-2,4'-piperidine]-5-ol?
The IUPAC name of spiro[3,4-dihydrochromene-2,4'-piperidine]-5-ol (CID 68756390) is spiro[3,4-dihydrochromene-2,4'-piperidine]-5-ol.
What is the SMILES notation for spiro[3,4-dihydrochromene-2,4'-piperidine]-5-ol?
The canonical SMILES for spiro[3,4-dihydrochromene-2,4'-piperidine]-5-ol is Oc1cccc2c1CCC1(CCNCC1)O2.
What is the InChIKey of spiro[3,4-dihydrochromene-2,4'-piperidine]-5-ol?
The InChIKey is CABJQXZPCFHITC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO2/c15-11-2-1-3-12-10(11)4-5-13(16-12)6-8-14-9-7-13/h1-3,14-15H,4-9H2.
What are the key properties of spiro[3,4-dihydrochromene-2,4'-piperidine]-5-ol?
spiro[3,4-dihydrochromene-2,4'-piperidine]-5-ol has a molecular weight of 219.28 g/mol, XLogP of 1.84, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[3,4-dihydrochromene-2,4'-piperidine]-5-ol is sourced from PubChem (CID 68756390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).