About 2-cyclopropylsulfonyl-2,8-diazaspiro[4.5]decan-1-one
2-cyclopropylsulfonyl-2,8-diazaspiro[4.5]decan-1-one (PubChem CID 68756517) has the molecular formula C11H18N2O3S
and a molecular weight of 258.34 g/mol. Its IUPAC name is 2-cyclopropylsulfonyl-2,8-diazaspiro[4.5]decan-1-one.
Molecular Properties
| Compound Name | 2-cyclopropylsulfonyl-2,8-diazaspiro[4.5]decan-1-one |
| PubChem CID | 68756517 |
| Molecular Formula | C11H18N2O3S |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 2-cyclopropylsulfonyl-2,8-diazaspiro[4.5]decan-1-one |
| SMILES | O=C1N(S(=O)(=O)C2CC2)CCC12CCNCC2 |
| InChI | InChI=1S/C11H18N2O3S/c14-10-11(3-6-12-7-4-11)5-8-13(10)17(15,16)9-1-2-9/h9,12H,1-8H2 |
| InChIKey | XSLAXOMQYQVCKJ-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-cyclopropylsulfonyl-2,8-diazaspiro[4.5]decan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropylsulfonyl-2,8-diazaspiro[4.5]decan-1-one?
The IUPAC name of 2-cyclopropylsulfonyl-2,8-diazaspiro[4.5]decan-1-one (CID 68756517) is 2-cyclopropylsulfonyl-2,8-diazaspiro[4.5]decan-1-one.
What is the SMILES notation for 2-cyclopropylsulfonyl-2,8-diazaspiro[4.5]decan-1-one?
The canonical SMILES for 2-cyclopropylsulfonyl-2,8-diazaspiro[4.5]decan-1-one is O=C1N(S(=O)(=O)C2CC2)CCC12CCNCC2.
What is the InChIKey of 2-cyclopropylsulfonyl-2,8-diazaspiro[4.5]decan-1-one?
The InChIKey is XSLAXOMQYQVCKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O3S/c14-10-11(3-6-12-7-4-11)5-8-13(10)17(15,16)9-1-2-9/h9,12H,1-8H2.
What are the key properties of 2-cyclopropylsulfonyl-2,8-diazaspiro[4.5]decan-1-one?
2-cyclopropylsulfonyl-2,8-diazaspiro[4.5]decan-1-one has a molecular weight of 258.34 g/mol, XLogP of 0.08, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropylsulfonyl-2,8-diazaspiro[4.5]decan-1-one is sourced from PubChem (CID 68756517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).