C36H40N4O2 — CID 68756671
N-[[(3S,5S)-3-(4-aminobutyl)-1-benzhydryl-2-oxo-1,4-diazepan-5-yl]methyl]-4-phenylbenzamide (PubChem CID 68756671) has the molecular formula C36H40N4O2 and a molecular weight of 560.74 g/mol. Its IUPAC name is N-[[(3S,5S)-3-(4-aminobutyl)-1-benzhydryl-2-oxo-1,4-diazepan-5-yl]methyl]-4-phenylbenzamide.
| Compound Name | N-[[(3S,5S)-3-(4-aminobutyl)-1-benzhydryl-2-oxo-1,4-diazepan-5-yl]methyl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 68756671 |
| Molecular Formula | C36H40N4O2 |
| Molecular Weight | 560.74 g/mol |
| Exact Mass | 560.32 |
| IUPAC Name | N-[[(3S,5S)-3-(4-aminobutyl)-1-benzhydryl-2-oxo-1,4-diazepan-5-yl]methyl]-4-phenylbenzamide |
| SMILES | NCCCC[C@@H]1N[C@H](CNC(=O)c2ccc(-c3ccccc3)cc2)CCN(C(c2ccccc2)c2ccccc2)C1=O |
| InChI | InChI=1S/C36H40N4O2/c37-24-11-10-18-33-36(42)40(34(29-14-6-2-7-15-29)30-16-8-3-9-17-30)25-23-32(39-33)26-38-35(41)31-21-19-28(20-22-31)27-12-4-1-5-13-27/h1-9,12-17,19-22,32-34,39H,10-11,18,23-26,37H2,(H,38,41)/t32-,33-/m0/s1 |
| InChIKey | DQKBXHRGWBTXCA-LQJZCPKCSA-N |
| XLogP | 5.56 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.74 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|