About 3-[6-(difluoromethoxy)-2,3-difluorophenyl]-2-phenylprop-2-enamide
3-[6-(difluoromethoxy)-2,3-difluorophenyl]-2-phenylprop-2-enamide (PubChem CID 68756761) has the molecular formula C16H11F4NO2
and a molecular weight of 325.26 g/mol. Its IUPAC name is 3-[6-(difluoromethoxy)-2,3-difluorophenyl]-2-phenylprop-2-enamide.
Molecular Properties
| Compound Name | 3-[6-(difluoromethoxy)-2,3-difluorophenyl]-2-phenylprop-2-enamide |
| PubChem CID | 68756761 |
| Molecular Formula | C16H11F4NO2 |
| Molecular Weight | 325.26 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | 3-[6-(difluoromethoxy)-2,3-difluorophenyl]-2-phenylprop-2-enamide |
| SMILES | NC(=O)C(=Cc1c(OC(F)F)ccc(F)c1F)c1ccccc1 |
| InChI | InChI=1S/C16H11F4NO2/c17-12-6-7-13(23-16(19)20)11(14(12)18)8-10(15(21)22)9-4-2-1-3-5-9/h1-8,16H,(H2,21,22) |
| InChIKey | FXTTXFNIEMYGAY-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.26 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 3-[6-(difluoromethoxy)-2,3-difluorophenyl]-2-phenylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[6-(difluoromethoxy)-2,3-difluorophenyl]-2-phenylprop-2-enamide?
The IUPAC name of 3-[6-(difluoromethoxy)-2,3-difluorophenyl]-2-phenylprop-2-enamide (CID 68756761) is 3-[6-(difluoromethoxy)-2,3-difluorophenyl]-2-phenylprop-2-enamide.
What is the SMILES notation for 3-[6-(difluoromethoxy)-2,3-difluorophenyl]-2-phenylprop-2-enamide?
The canonical SMILES for 3-[6-(difluoromethoxy)-2,3-difluorophenyl]-2-phenylprop-2-enamide is NC(=O)C(=Cc1c(OC(F)F)ccc(F)c1F)c1ccccc1.
What is the InChIKey of 3-[6-(difluoromethoxy)-2,3-difluorophenyl]-2-phenylprop-2-enamide?
The InChIKey is FXTTXFNIEMYGAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11F4NO2/c17-12-6-7-13(23-16(19)20)11(14(12)18)8-10(15(21)22)9-4-2-1-3-5-9/h1-8,16H,(H2,21,22).
What are the key properties of 3-[6-(difluoromethoxy)-2,3-difluorophenyl]-2-phenylprop-2-enamide?
3-[6-(difluoromethoxy)-2,3-difluorophenyl]-2-phenylprop-2-enamide has a molecular weight of 325.26 g/mol, XLogP of 3.59, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[6-(difluoromethoxy)-2,3-difluorophenyl]-2-phenylprop-2-enamide is sourced from PubChem (CID 68756761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).