About 4-bromo-2,6-diethylbenzamide
4-bromo-2,6-diethylbenzamide (PubChem CID 68757322) has the molecular formula C11H14BrNO
and a molecular weight of 256.14 g/mol. Its IUPAC name is 4-bromo-2,6-diethylbenzamide.
Molecular Properties
| Compound Name | 4-bromo-2,6-diethylbenzamide |
| PubChem CID | 68757322 |
| Molecular Formula | C11H14BrNO |
| Molecular Weight | 256.14 g/mol |
| Exact Mass | 255.03 |
| IUPAC Name | 4-bromo-2,6-diethylbenzamide |
| SMILES | CCc1cc(Br)cc(CC)c1C(N)=O |
| InChI | InChI=1S/C11H14BrNO/c1-3-7-5-9(12)6-8(4-2)10(7)11(13)14/h5-6H,3-4H2,1-2H3,(H2,13,14) |
| InChIKey | QVFMLSIUCHBRQQ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.14 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-bromo-2,6-diethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2,6-diethylbenzamide?
The IUPAC name of 4-bromo-2,6-diethylbenzamide (CID 68757322) is 4-bromo-2,6-diethylbenzamide.
What is the SMILES notation for 4-bromo-2,6-diethylbenzamide?
The canonical SMILES for 4-bromo-2,6-diethylbenzamide is CCc1cc(Br)cc(CC)c1C(N)=O.
What is the InChIKey of 4-bromo-2,6-diethylbenzamide?
The InChIKey is QVFMLSIUCHBRQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14BrNO/c1-3-7-5-9(12)6-8(4-2)10(7)11(13)14/h5-6H,3-4H2,1-2H3,(H2,13,14).
What are the key properties of 4-bromo-2,6-diethylbenzamide?
4-bromo-2,6-diethylbenzamide has a molecular weight of 256.14 g/mol, XLogP of 2.67, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2,6-diethylbenzamide is sourced from PubChem (CID 68757322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).