2-(5-cyclopentyl-1,2,4-oxadiazol-3-yl)ethylcarbamic acid

C10H15N3O3 — CID 68758104

IUPAC2-(5-cyclopentyl-1,2,4-oxadiazol-3-yl)ethylcarbamic acid
SMILESO=C(O)NCCc1noc(C2CCCC2)n1
InChIInChI=1S/C10H15N3O3/c14-10(15)11-6-5-8-12-9(16-13-8)7-3-1-2-4-7/h7,11H,1-6H2,(H,14,15)
InChIKeyFIUKYSMPOMDYNO-UHFFFAOYSA-N
MW225.25 g/mol
LogP1.54
Rot. Bonds4

About 2-(5-cyclopentyl-1,2,4-oxadiazol-3-yl)ethylcarbamic acid

2-(5-cyclopentyl-1,2,4-oxadiazol-3-yl)ethylcarbamic acid (PubChem CID 68758104) has the molecular formula C10H15N3O3 and a molecular weight of 225.25 g/mol. Its IUPAC name is 2-(5-cyclopentyl-1,2,4-oxadiazol-3-yl)ethylcarbamic acid.

Molecular Properties

Compound Name2-(5-cyclopentyl-1,2,4-oxadiazol-3-yl)ethylcarbamic acid
PubChem CID68758104
Molecular FormulaC10H15N3O3
Molecular Weight225.25 g/mol
Exact Mass225.11
IUPAC Name2-(5-cyclopentyl-1,2,4-oxadiazol-3-yl)ethylcarbamic acid
SMILESO=C(O)NCCc1noc(C2CCCC2)n1
InChIInChI=1S/C10H15N3O3/c14-10(15)11-6-5-8-12-9(16-13-8)7-3-1-2-4-7/h7,11H,1-6H2,(H,14,15)
InChIKeyFIUKYSMPOMDYNO-UHFFFAOYSA-N
XLogP1.54
TPSA88.25 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500225.25
LogP ≤ 51.54
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-(5-cyclopentyl-1,2,4-oxadiazol-3-yl)ethylcarbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(5-cyclopentyl-1,2,4-oxadiazol-3-yl)ethylcarbamic acid?
The IUPAC name of 2-(5-cyclopentyl-1,2,4-oxadiazol-3-yl)ethylcarbamic acid (CID 68758104) is 2-(5-cyclopentyl-1,2,4-oxadiazol-3-yl)ethylcarbamic acid.
What is the SMILES notation for 2-(5-cyclopentyl-1,2,4-oxadiazol-3-yl)ethylcarbamic acid?
The canonical SMILES for 2-(5-cyclopentyl-1,2,4-oxadiazol-3-yl)ethylcarbamic acid is O=C(O)NCCc1noc(C2CCCC2)n1.
What is the InChIKey of 2-(5-cyclopentyl-1,2,4-oxadiazol-3-yl)ethylcarbamic acid?
The InChIKey is FIUKYSMPOMDYNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O3/c14-10(15)11-6-5-8-12-9(16-13-8)7-3-1-2-4-7/h7,11H,1-6H2,(H,14,15).
What are the key properties of 2-(5-cyclopentyl-1,2,4-oxadiazol-3-yl)ethylcarbamic acid?
2-(5-cyclopentyl-1,2,4-oxadiazol-3-yl)ethylcarbamic acid has a molecular weight of 225.25 g/mol, XLogP of 1.54, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-cyclopentyl-1,2,4-oxadiazol-3-yl)ethylcarbamic acid is sourced from PubChem (CID 68758104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).