C27H27N3O4 — CID 68758208
4-[6-tert-butyl-5-methoxy-8-(6-methoxy-2-oxo-1H-pyridin-3-yl)quinolin-3-yl]benzamide (PubChem CID 68758208) has the molecular formula C27H27N3O4 and a molecular weight of 457.53 g/mol. Its IUPAC name is 4-[6-tert-butyl-5-methoxy-8-(6-methoxy-2-oxo-1H-pyridin-3-yl)quinolin-3-yl]benzamide.
| Compound Name | 4-[6-tert-butyl-5-methoxy-8-(6-methoxy-2-oxo-1H-pyridin-3-yl)quinolin-3-yl]benzamide |
|---|---|
| PubChem CID | 68758208 |
| Molecular Formula | C27H27N3O4 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | 4-[6-tert-butyl-5-methoxy-8-(6-methoxy-2-oxo-1H-pyridin-3-yl)quinolin-3-yl]benzamide |
| SMILES | COc1ccc(-c2cc(C(C)(C)C)c(OC)c3cc(-c4ccc(C(N)=O)cc4)cnc23)c(=O)[nH]1 |
| InChI | InChI=1S/C27H27N3O4/c1-27(2,3)21-13-19(18-10-11-22(33-4)30-26(18)32)23-20(24(21)34-5)12-17(14-29-23)15-6-8-16(9-7-15)25(28)31/h6-14H,1-5H3,(H2,28,31)(H,30,32) |
| InChIKey | WTERZHCEGAOWPY-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |