About CID 68758374
CID 68758374 (PubChem CID 68758374) has the molecular formula C15H29O2Si
and a molecular weight of 269.48 g/mol.
Molecular Properties
| Compound Name | CID 68758374 |
| PubChem CID | 68758374 |
| Molecular Formula | C15H29O2Si |
| Molecular Weight | 269.48 g/mol |
| Exact Mass | 269.19 |
| IUPAC Name | — |
| SMILES | CCCC[Si](OCC)OC(C)=CC1CCCCC1 |
| InChI | InChI=1S/C15H29O2Si/c1-4-6-12-18(16-5-2)17-14(3)13-15-10-8-7-9-11-15/h13,15H,4-12H2,1-3H3 |
| InChIKey | YVBPZOTZJYKYOR-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.48 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 68758374 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 68758374?
The IUPAC name of CID 68758374 (CID 68758374) is not available.
What is the SMILES notation for CID 68758374?
The canonical SMILES for CID 68758374 is CCCC[Si](OCC)OC(C)=CC1CCCCC1.
What is the InChIKey of CID 68758374?
The InChIKey is YVBPZOTZJYKYOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H29O2Si/c1-4-6-12-18(16-5-2)17-14(3)13-15-10-8-7-9-11-15/h13,15H,4-12H2,1-3H3.
What are the key properties of CID 68758374?
CID 68758374 has a molecular weight of 269.48 g/mol, XLogP of 4.81, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 68758374 is sourced from PubChem (CID 68758374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).