About methyl 3-(5-methyl-2-pyridinyl)-5-(5-propan-2-yl-1,2,4-triazol-1-yl)benzoate;2-methylpropanamide
methyl 3-(5-methyl-2-pyridinyl)-5-(5-propan-2-yl-1,2,4-triazol-1-yl)benzoate;2-methylpropanamide (PubChem CID 68758986) has the molecular formula C23H29N5O3
and a molecular weight of 423.52 g/mol. Its IUPAC name is methyl 3-(5-methyl-2-pyridinyl)-5-(5-propan-2-yl-1,2,4-triazol-1-yl)benzoate;2-methylpropanamide.
Molecular Properties
| Compound Name | methyl 3-(5-methyl-2-pyridinyl)-5-(5-propan-2-yl-1,2,4-triazol-1-yl)benzoate;2-methylpropanamide |
| PubChem CID | 68758986 |
| Molecular Formula | C23H29N5O3 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.23 |
| IUPAC Name | methyl 3-(5-methyl-2-pyridinyl)-5-(5-propan-2-yl-1,2,4-triazol-1-yl)benzoate;2-methylpropanamide |
| SMILES | CC(C)C(N)=O.COC(=O)c1cc(-c2ccc(C)cn2)cc(-n2ncnc2C(C)C)c1 |
| InChI | InChI=1S/C19H20N4O2.C4H9NO/c1-12(2)18-21-11-22-23(18)16-8-14(7-15(9-16)19(24)25-4)17-6-5-13(3)10-20-17;1-3(2)4(5)6/h5-12H,1-4H3;3H,1-2H3,(H2,5,6) |
| InChIKey | FUWAGVJEMMYKOO-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 112.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 3-(5-methyl-2-pyridinyl)-5-(5-propan-2-yl-1,2,4-triazol-1-yl)benzoate;2-methylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(5-methyl-2-pyridinyl)-5-(5-propan-2-yl-1,2,4-triazol-1-yl)benzoate;2-methylpropanamide?
The IUPAC name of methyl 3-(5-methyl-2-pyridinyl)-5-(5-propan-2-yl-1,2,4-triazol-1-yl)benzoate;2-methylpropanamide (CID 68758986) is methyl 3-(5-methyl-2-pyridinyl)-5-(5-propan-2-yl-1,2,4-triazol-1-yl)benzoate;2-methylpropanamide.
What is the SMILES notation for methyl 3-(5-methyl-2-pyridinyl)-5-(5-propan-2-yl-1,2,4-triazol-1-yl)benzoate;2-methylpropanamide?
The canonical SMILES for methyl 3-(5-methyl-2-pyridinyl)-5-(5-propan-2-yl-1,2,4-triazol-1-yl)benzoate;2-methylpropanamide is CC(C)C(N)=O.COC(=O)c1cc(-c2ccc(C)cn2)cc(-n2ncnc2C(C)C)c1.
What is the InChIKey of methyl 3-(5-methyl-2-pyridinyl)-5-(5-propan-2-yl-1,2,4-triazol-1-yl)benzoate;2-methylpropanamide?
The InChIKey is FUWAGVJEMMYKOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N4O2.C4H9NO/c1-12(2)18-21-11-22-23(18)16-8-14(7-15(9-16)19(24)25-4)17-6-5-13(3)10-20-17;1-3(2)4(5)6/h5-12H,1-4H3;3H,1-2H3,(H2,5,6).
What are the key properties of methyl 3-(5-methyl-2-pyridinyl)-5-(5-propan-2-yl-1,2,4-triazol-1-yl)benzoate;2-methylpropanamide?
methyl 3-(5-methyl-2-pyridinyl)-5-(5-propan-2-yl-1,2,4-triazol-1-yl)benzoate;2-methylpropanamide has a molecular weight of 423.52 g/mol, XLogP of 3.68, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(5-methyl-2-pyridinyl)-5-(5-propan-2-yl-1,2,4-triazol-1-yl)benzoate;2-methylpropanamide is sourced from PubChem (CID 68758986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).