C31H36FN3O2 — CID 68759556
N-[1-[(4R,5R)-1-(4-fluorophenyl)-4-methyl-5,6,7,8-tetrahydro-4H-cyclopenta[f]indazol-5-yl]pentan-2-yl]-3-(3-hydroxyphenyl)propanamide (PubChem CID 68759556) has the molecular formula C31H36FN3O2 and a molecular weight of 501.65 g/mol. Its IUPAC name is N-[1-[(4R,5R)-1-(4-fluorophenyl)-4-methyl-5,6,7,8-tetrahydro-4H-cyclopenta[f]indazol-5-yl]pentan-2-yl]-3-(3-hydroxyphenyl)propanamide.
| Compound Name | N-[1-[(4R,5R)-1-(4-fluorophenyl)-4-methyl-5,6,7,8-tetrahydro-4H-cyclopenta[f]indazol-5-yl]pentan-2-yl]-3-(3-hydroxyphenyl)propanamide |
|---|---|
| PubChem CID | 68759556 |
| Molecular Formula | C31H36FN3O2 |
| Molecular Weight | 501.65 g/mol |
| Exact Mass | 501.28 |
| IUPAC Name | N-[1-[(4R,5R)-1-(4-fluorophenyl)-4-methyl-5,6,7,8-tetrahydro-4H-cyclopenta[f]indazol-5-yl]pentan-2-yl]-3-(3-hydroxyphenyl)propanamide |
| SMILES | CCCC(C[C@H]1CCC2=C1[C@@H](C)c1cnn(-c3ccc(F)cc3)c1C2)NC(=O)CCc1cccc(O)c1 |
| InChI | InChI=1S/C31H36FN3O2/c1-3-5-25(34-30(37)15-8-21-6-4-7-27(36)16-21)17-22-9-10-23-18-29-28(20(2)31(22)23)19-33-35(29)26-13-11-24(32)12-14-26/h4,6-7,11-14,16,19-20,22,25,36H,3,5,8-10,15,17-18H2,1-2H3,(H,34,37)/t20-,22+,25?/m0/s1 |
| InChIKey | FGTBKNSBSCKOJR-IZEQZHGBSA-N |
| XLogP | 6.39 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.65 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|