About 1-(trifluoromethyl)-5,7-dihydroindolo[2,3-b]carbazole
1-(trifluoromethyl)-5,7-dihydroindolo[2,3-b]carbazole (PubChem CID 68760063) has the molecular formula C19H11F3N2
and a molecular weight of 324.31 g/mol. Its IUPAC name is 1-(trifluoromethyl)-5,7-dihydroindolo[2,3-b]carbazole.
Molecular Properties
| Compound Name | 1-(trifluoromethyl)-5,7-dihydroindolo[2,3-b]carbazole |
| PubChem CID | 68760063 |
| Molecular Formula | C19H11F3N2 |
| Molecular Weight | 324.31 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | 1-(trifluoromethyl)-5,7-dihydroindolo[2,3-b]carbazole |
| SMILES | FC(F)(F)c1cccc2[nH]c3cc4[nH]c5ccccc5c4cc3c12 |
| InChI | InChI=1S/C19H11F3N2/c20-19(21,22)13-5-3-7-15-18(13)12-8-11-10-4-1-2-6-14(10)23-16(11)9-17(12)24-15/h1-9,23-24H |
| InChIKey | VJYNSYXFWFJAJI-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 324.31 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-(trifluoromethyl)-5,7-dihydroindolo[2,3-b]carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(trifluoromethyl)-5,7-dihydroindolo[2,3-b]carbazole?
The IUPAC name of 1-(trifluoromethyl)-5,7-dihydroindolo[2,3-b]carbazole (CID 68760063) is 1-(trifluoromethyl)-5,7-dihydroindolo[2,3-b]carbazole.
What is the SMILES notation for 1-(trifluoromethyl)-5,7-dihydroindolo[2,3-b]carbazole?
The canonical SMILES for 1-(trifluoromethyl)-5,7-dihydroindolo[2,3-b]carbazole is FC(F)(F)c1cccc2[nH]c3cc4[nH]c5ccccc5c4cc3c12.
What is the InChIKey of 1-(trifluoromethyl)-5,7-dihydroindolo[2,3-b]carbazole?
The InChIKey is VJYNSYXFWFJAJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H11F3N2/c20-19(21,22)13-5-3-7-15-18(13)12-8-11-10-4-1-2-6-14(10)23-16(11)9-17(12)24-15/h1-9,23-24H.
What are the key properties of 1-(trifluoromethyl)-5,7-dihydroindolo[2,3-b]carbazole?
1-(trifluoromethyl)-5,7-dihydroindolo[2,3-b]carbazole has a molecular weight of 324.31 g/mol, XLogP of 5.97, 0 rotatable bonds, 2 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(trifluoromethyl)-5,7-dihydroindolo[2,3-b]carbazole is sourced from PubChem (CID 68760063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).