About 2-[(2S)-1,1,1-trifluoropropan-2-yl]pyrimidine-5-sulfonamide
2-[(2S)-1,1,1-trifluoropropan-2-yl]pyrimidine-5-sulfonamide (PubChem CID 68760263) has the molecular formula C7H8F3N3O2S
and a molecular weight of 255.22 g/mol. Its IUPAC name is 2-[(2S)-1,1,1-trifluoropropan-2-yl]pyrimidine-5-sulfonamide.
Molecular Properties
| Compound Name | 2-[(2S)-1,1,1-trifluoropropan-2-yl]pyrimidine-5-sulfonamide |
| PubChem CID | 68760263 |
| Molecular Formula | C7H8F3N3O2S |
| Molecular Weight | 255.22 g/mol |
| Exact Mass | 255.03 |
| IUPAC Name | 2-[(2S)-1,1,1-trifluoropropan-2-yl]pyrimidine-5-sulfonamide |
| SMILES | C[C@@H](c1ncc(S(N)(=O)=O)cn1)C(F)(F)F |
| InChI | InChI=1S/C7H8F3N3O2S/c1-4(7(8,9)10)6-12-2-5(3-13-6)16(11,14)15/h2-4H,1H3,(H2,11,14,15)/t4-/m0/s1 |
| InChIKey | JJPUGDXBAGORIH-BYPYZUCNSA-N |
| XLogP | 0.79 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.22 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(2S)-1,1,1-trifluoropropan-2-yl]pyrimidine-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2S)-1,1,1-trifluoropropan-2-yl]pyrimidine-5-sulfonamide?
The IUPAC name of 2-[(2S)-1,1,1-trifluoropropan-2-yl]pyrimidine-5-sulfonamide (CID 68760263) is 2-[(2S)-1,1,1-trifluoropropan-2-yl]pyrimidine-5-sulfonamide.
What is the SMILES notation for 2-[(2S)-1,1,1-trifluoropropan-2-yl]pyrimidine-5-sulfonamide?
The canonical SMILES for 2-[(2S)-1,1,1-trifluoropropan-2-yl]pyrimidine-5-sulfonamide is C[C@@H](c1ncc(S(N)(=O)=O)cn1)C(F)(F)F.
What is the InChIKey of 2-[(2S)-1,1,1-trifluoropropan-2-yl]pyrimidine-5-sulfonamide?
The InChIKey is JJPUGDXBAGORIH-BYPYZUCNSA-N. The full InChI is InChI=1S/C7H8F3N3O2S/c1-4(7(8,9)10)6-12-2-5(3-13-6)16(11,14)15/h2-4H,1H3,(H2,11,14,15)/t4-/m0/s1.
What are the key properties of 2-[(2S)-1,1,1-trifluoropropan-2-yl]pyrimidine-5-sulfonamide?
2-[(2S)-1,1,1-trifluoropropan-2-yl]pyrimidine-5-sulfonamide has a molecular weight of 255.22 g/mol, XLogP of 0.79, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2S)-1,1,1-trifluoropropan-2-yl]pyrimidine-5-sulfonamide is sourced from PubChem (CID 68760263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).