About (1S)-1-iodo-1-(2,3,4-trichlorophenyl)ethanamine
(1S)-1-iodo-1-(2,3,4-trichlorophenyl)ethanamine (PubChem CID 68760299) has the molecular formula C8H7Cl3IN
and a molecular weight of 350.41 g/mol. Its IUPAC name is (1S)-1-iodo-1-(2,3,4-trichlorophenyl)ethanamine.
Molecular Properties
| Compound Name | (1S)-1-iodo-1-(2,3,4-trichlorophenyl)ethanamine |
| PubChem CID | 68760299 |
| Molecular Formula | C8H7Cl3IN |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 348.87 |
| IUPAC Name | (1S)-1-iodo-1-(2,3,4-trichlorophenyl)ethanamine |
| SMILES | C[C@](N)(I)c1ccc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C8H7Cl3IN/c1-8(12,13)4-2-3-5(9)7(11)6(4)10/h2-3H,13H2,1H3/t8-/m1/s1 |
| InChIKey | IITIXMPUZGHTOJ-MRVPVSSYSA-N |
| XLogP | 4.21 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze (1S)-1-iodo-1-(2,3,4-trichlorophenyl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-iodo-1-(2,3,4-trichlorophenyl)ethanamine?
The IUPAC name of (1S)-1-iodo-1-(2,3,4-trichlorophenyl)ethanamine (CID 68760299) is (1S)-1-iodo-1-(2,3,4-trichlorophenyl)ethanamine.
What is the SMILES notation for (1S)-1-iodo-1-(2,3,4-trichlorophenyl)ethanamine?
The canonical SMILES for (1S)-1-iodo-1-(2,3,4-trichlorophenyl)ethanamine is C[C@](N)(I)c1ccc(Cl)c(Cl)c1Cl.
What is the InChIKey of (1S)-1-iodo-1-(2,3,4-trichlorophenyl)ethanamine?
The InChIKey is IITIXMPUZGHTOJ-MRVPVSSYSA-N. The full InChI is InChI=1S/C8H7Cl3IN/c1-8(12,13)4-2-3-5(9)7(11)6(4)10/h2-3H,13H2,1H3/t8-/m1/s1.
What are the key properties of (1S)-1-iodo-1-(2,3,4-trichlorophenyl)ethanamine?
(1S)-1-iodo-1-(2,3,4-trichlorophenyl)ethanamine has a molecular weight of 350.41 g/mol, XLogP of 4.21, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-iodo-1-(2,3,4-trichlorophenyl)ethanamine is sourced from PubChem (CID 68760299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).