About morpholine;thieno[3,2-d]pyrimidine
morpholine;thieno[3,2-d]pyrimidine (PubChem CID 68760421) has the molecular formula C10H13N3OS
and a molecular weight of 223.30 g/mol. Its IUPAC name is morpholine;thieno[3,2-d]pyrimidine.
Molecular Properties
| Compound Name | morpholine;thieno[3,2-d]pyrimidine |
| PubChem CID | 68760421 |
| Molecular Formula | C10H13N3OS |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | morpholine;thieno[3,2-d]pyrimidine |
| SMILES | C1COCCN1.c1ncc2sccc2n1 |
| InChI | InChI=1S/C6H4N2S.C4H9NO/c1-2-9-6-3-7-4-8-5(1)6;1-3-6-4-2-5-1/h1-4H;5H,1-4H2 |
| InChIKey | KZOPSSGUPSMGBG-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze morpholine;thieno[3,2-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of morpholine;thieno[3,2-d]pyrimidine?
The IUPAC name of morpholine;thieno[3,2-d]pyrimidine (CID 68760421) is morpholine;thieno[3,2-d]pyrimidine.
What is the SMILES notation for morpholine;thieno[3,2-d]pyrimidine?
The canonical SMILES for morpholine;thieno[3,2-d]pyrimidine is C1COCCN1.c1ncc2sccc2n1.
What is the InChIKey of morpholine;thieno[3,2-d]pyrimidine?
The InChIKey is KZOPSSGUPSMGBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N2S.C4H9NO/c1-2-9-6-3-7-4-8-5(1)6;1-3-6-4-2-5-1/h1-4H;5H,1-4H2.
What are the key properties of morpholine;thieno[3,2-d]pyrimidine?
morpholine;thieno[3,2-d]pyrimidine has a molecular weight of 223.30 g/mol, XLogP of 1.30, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for morpholine;thieno[3,2-d]pyrimidine is sourced from PubChem (CID 68760421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).