C20H20N4 — CID 68760807
17,21-dimethyl-4,11,19,20-tetrazapentacyclo[12.8.0.01,18.02,7.08,13]docosa-2(7),3,11,13,15,17,19,21-octaene (PubChem CID 68760807) has the molecular formula C20H20N4 and a molecular weight of 316.41 g/mol. Its IUPAC name is 17,21-dimethyl-4,11,19,20-tetrazapentacyclo[12.8.0.01,18.02,7.08,13]docosa-2(7),3,11,13,15,17,19,21-octaene.
| Compound Name | 17,21-dimethyl-4,11,19,20-tetrazapentacyclo[12.8.0.01,18.02,7.08,13]docosa-2(7),3,11,13,15,17,19,21-octaene |
|---|---|
| PubChem CID | 68760807 |
| Molecular Formula | C20H20N4 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | 17,21-dimethyl-4,11,19,20-tetrazapentacyclo[12.8.0.01,18.02,7.08,13]docosa-2(7),3,11,13,15,17,19,21-octaene |
| SMILES | CC1=CC23C(=C4C=NCCC4C4=C2C=NCC4)C=CC(C)=C3N=N1 |
| InChI | InChI=1S/C20H20N4/c1-12-3-4-17-16-10-21-7-5-14(16)15-6-8-22-11-18(15)20(17)9-13(2)23-24-19(12)20/h3-4,9-11,14H,5-8H2,1-2H3 |
| InChIKey | LXXFQLKCNDVKBU-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |