About 4-[4-(3-oxa-8-azabicyclo[3.2.1]octan-8-yl)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]aniline
4-[4-(3-oxa-8-azabicyclo[3.2.1]octan-8-yl)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]aniline (PubChem CID 68760923) has the molecular formula C19H22N4O2
and a molecular weight of 338.41 g/mol. Its IUPAC name is 4-[4-(3-oxa-8-azabicyclo[3.2.1]octan-8-yl)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]aniline.
Molecular Properties
| Compound Name | 4-[4-(3-oxa-8-azabicyclo[3.2.1]octan-8-yl)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]aniline |
| PubChem CID | 68760923 |
| Molecular Formula | C19H22N4O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 4-[4-(3-oxa-8-azabicyclo[3.2.1]octan-8-yl)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]aniline |
| SMILES | Nc1ccc(-c2nc3c(c(N4C5CCC4COC5)n2)COCC3)cc1 |
| InChI | InChI=1S/C19H22N4O2/c20-13-3-1-12(2-4-13)18-21-17-7-8-24-11-16(17)19(22-18)23-14-5-6-15(23)10-25-9-14/h1-4,14-15H,5-11,20H2 |
| InChIKey | SJUAQEGPOKSKGA-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 73.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-(3-oxa-8-azabicyclo[3.2.1]octan-8-yl)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(3-oxa-8-azabicyclo[3.2.1]octan-8-yl)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]aniline?
The IUPAC name of 4-[4-(3-oxa-8-azabicyclo[3.2.1]octan-8-yl)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]aniline (CID 68760923) is 4-[4-(3-oxa-8-azabicyclo[3.2.1]octan-8-yl)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]aniline.
What is the SMILES notation for 4-[4-(3-oxa-8-azabicyclo[3.2.1]octan-8-yl)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]aniline?
The canonical SMILES for 4-[4-(3-oxa-8-azabicyclo[3.2.1]octan-8-yl)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]aniline is Nc1ccc(-c2nc3c(c(N4C5CCC4COC5)n2)COCC3)cc1.
What is the InChIKey of 4-[4-(3-oxa-8-azabicyclo[3.2.1]octan-8-yl)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]aniline?
The InChIKey is SJUAQEGPOKSKGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N4O2/c20-13-3-1-12(2-4-13)18-21-17-7-8-24-11-16(17)19(22-18)23-14-5-6-15(23)10-25-9-14/h1-4,14-15H,5-11,20H2.
What are the key properties of 4-[4-(3-oxa-8-azabicyclo[3.2.1]octan-8-yl)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]aniline?
4-[4-(3-oxa-8-azabicyclo[3.2.1]octan-8-yl)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]aniline has a molecular weight of 338.41 g/mol, XLogP of 2.17, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(3-oxa-8-azabicyclo[3.2.1]octan-8-yl)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]aniline is sourced from PubChem (CID 68760923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).