C27H34N4O2 — CID 68761040
1-[3-[(E)-hept-1-enyl]-9H-pyrido[2,3-b]indol-6-yl]-4-(4-methylpiperazin-1-yl)butane-1,4-dione (PubChem CID 68761040) has the molecular formula C27H34N4O2 and a molecular weight of 446.60 g/mol. Its IUPAC name is 1-[3-[(E)-hept-1-enyl]-9H-pyrido[2,3-b]indol-6-yl]-4-(4-methylpiperazin-1-yl)butane-1,4-dione.
| Compound Name | 1-[3-[(E)-hept-1-enyl]-9H-pyrido[2,3-b]indol-6-yl]-4-(4-methylpiperazin-1-yl)butane-1,4-dione |
|---|---|
| PubChem CID | 68761040 |
| Molecular Formula | C27H34N4O2 |
| Molecular Weight | 446.60 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | 1-[3-[(E)-hept-1-enyl]-9H-pyrido[2,3-b]indol-6-yl]-4-(4-methylpiperazin-1-yl)butane-1,4-dione |
| SMILES | CCCCC/C=C/c1cnc2[nH]c3ccc(C(=O)CCC(=O)N4CCN(C)CC4)cc3c2c1 |
| InChI | InChI=1S/C27H34N4O2/c1-3-4-5-6-7-8-20-17-23-22-18-21(9-10-24(22)29-27(23)28-19-20)25(32)11-12-26(33)31-15-13-30(2)14-16-31/h7-10,17-19H,3-6,11-16H2,1-2H3,(H,28,29)/b8-7+ |
| InChIKey | IZVBJSUKXDCEME-BQYQJAHWSA-N |
| XLogP | 5.05 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.60 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|