About CID 68761393
CID 68761393 (PubChem CID 68761393) has the molecular formula C6H13CaNO3S
and a molecular weight of 219.32 g/mol.
Molecular Properties
| Compound Name | CID 68761393 |
| PubChem CID | 68761393 |
| Molecular Formula | C6H13CaNO3S |
| Molecular Weight | 219.32 g/mol |
| Exact Mass | 219.02 |
| IUPAC Name | — |
| SMILES | O=S(=O)(O)NC1CCCCC1.[Ca] |
| InChI | InChI=1S/C6H13NO3S.Ca/c8-11(9,10)7-6-4-2-1-3-5-6;/h6-7H,1-5H2,(H,8,9,10); |
| InChIKey | NNIBNVDPXQQNTD-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.32 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze CID 68761393 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 68761393?
The IUPAC name of CID 68761393 (CID 68761393) is not available.
What is the SMILES notation for CID 68761393?
The canonical SMILES for CID 68761393 is O=S(=O)(O)NC1CCCCC1.[Ca].
What is the InChIKey of CID 68761393?
The InChIKey is NNIBNVDPXQQNTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO3S.Ca/c8-11(9,10)7-6-4-2-1-3-5-6;/h6-7H,1-5H2,(H,8,9,10);.
What are the key properties of CID 68761393?
CID 68761393 has a molecular weight of 219.32 g/mol, XLogP of 0.33, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 68761393 is sourced from PubChem (CID 68761393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).