C18H24ClN7O — CID 68761927
2-[[[5-(3-aminopropylamino)-3-propan-2-yl-2H-pyrazolo[4,3-d]pyrimidin-7-yl]amino]methyl]-4-chlorophenol (PubChem CID 68761927) has the molecular formula C18H24ClN7O and a molecular weight of 389.89 g/mol. Its IUPAC name is 2-[[[5-(3-aminopropylamino)-3-propan-2-yl-2H-pyrazolo[4,3-d]pyrimidin-7-yl]amino]methyl]-4-chlorophenol.
| Compound Name | 2-[[[5-(3-aminopropylamino)-3-propan-2-yl-2H-pyrazolo[4,3-d]pyrimidin-7-yl]amino]methyl]-4-chlorophenol |
|---|---|
| PubChem CID | 68761927 |
| Molecular Formula | C18H24ClN7O |
| Molecular Weight | 389.89 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | 2-[[[5-(3-aminopropylamino)-3-propan-2-yl-2H-pyrazolo[4,3-d]pyrimidin-7-yl]amino]methyl]-4-chlorophenol |
| SMILES | CC(C)c1[nH]nc2c(NCc3cc(Cl)ccc3O)nc(NCCCN)nc12 |
| InChI | InChI=1S/C18H24ClN7O/c1-10(2)14-15-16(26-25-14)17(24-18(23-15)21-7-3-6-20)22-9-11-8-12(19)4-5-13(11)27/h4-5,8,10,27H,3,6-7,9,20H2,1-2H3,(H,25,26)(H2,21,22,23,24) |
| InChIKey | RKGBDUUTDMBRIY-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 124.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.89 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|