C23H24N2O — CID 68762162
6-(4-methoxyphenyl)-2-pentyl-9H-pyrido[2,3-b]indole (PubChem CID 68762162) has the molecular formula C23H24N2O and a molecular weight of 344.46 g/mol. Its IUPAC name is 6-(4-methoxyphenyl)-2-pentyl-9H-pyrido[2,3-b]indole.
| Compound Name | 6-(4-methoxyphenyl)-2-pentyl-9H-pyrido[2,3-b]indole |
|---|---|
| PubChem CID | 68762162 |
| Molecular Formula | C23H24N2O |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | 6-(4-methoxyphenyl)-2-pentyl-9H-pyrido[2,3-b]indole |
| SMILES | CCCCCc1ccc2c(n1)[nH]c1ccc(-c3ccc(OC)cc3)cc12 |
| InChI | InChI=1S/C23H24N2O/c1-3-4-5-6-18-10-13-20-21-15-17(9-14-22(21)25-23(20)24-18)16-7-11-19(26-2)12-8-16/h7-15H,3-6H2,1-2H3,(H,24,25) |
| InChIKey | WFZVZOQFVQPMBS-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|