About 2-(2,5-dioxopyrrolidin-1-yl)oxyethyl prop-2-enoate
2-(2,5-dioxopyrrolidin-1-yl)oxyethyl prop-2-enoate (PubChem CID 68762807) has the molecular formula C9H11NO5
and a molecular weight of 213.19 g/mol. Its IUPAC name is 2-(2,5-dioxopyrrolidin-1-yl)oxyethyl prop-2-enoate.
Molecular Properties
| Compound Name | 2-(2,5-dioxopyrrolidin-1-yl)oxyethyl prop-2-enoate |
| PubChem CID | 68762807 |
| Molecular Formula | C9H11NO5 |
| Molecular Weight | 213.19 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | 2-(2,5-dioxopyrrolidin-1-yl)oxyethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCON1C(=O)CCC1=O |
| InChI | InChI=1S/C9H11NO5/c1-2-9(13)14-5-6-15-10-7(11)3-4-8(10)12/h2H,1,3-6H2 |
| InChIKey | WVFXUYHYSSWQJM-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.19 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,5-dioxopyrrolidin-1-yl)oxyethyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-dioxopyrrolidin-1-yl)oxyethyl prop-2-enoate?
The IUPAC name of 2-(2,5-dioxopyrrolidin-1-yl)oxyethyl prop-2-enoate (CID 68762807) is 2-(2,5-dioxopyrrolidin-1-yl)oxyethyl prop-2-enoate.
What is the SMILES notation for 2-(2,5-dioxopyrrolidin-1-yl)oxyethyl prop-2-enoate?
The canonical SMILES for 2-(2,5-dioxopyrrolidin-1-yl)oxyethyl prop-2-enoate is C=CC(=O)OCCON1C(=O)CCC1=O.
What is the InChIKey of 2-(2,5-dioxopyrrolidin-1-yl)oxyethyl prop-2-enoate?
The InChIKey is WVFXUYHYSSWQJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO5/c1-2-9(13)14-5-6-15-10-7(11)3-4-8(10)12/h2H,1,3-6H2.
What are the key properties of 2-(2,5-dioxopyrrolidin-1-yl)oxyethyl prop-2-enoate?
2-(2,5-dioxopyrrolidin-1-yl)oxyethyl prop-2-enoate has a molecular weight of 213.19 g/mol, XLogP of -0.20, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dioxopyrrolidin-1-yl)oxyethyl prop-2-enoate is sourced from PubChem (CID 68762807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).