About 9-(benzenesulfonyl)-6-[1-(2-fluorophenyl)ethenyl]-4-pentylpyrido[2,3-b]indole
9-(benzenesulfonyl)-6-[1-(2-fluorophenyl)ethenyl]-4-pentylpyrido[2,3-b]indole (PubChem CID 68763110) has the molecular formula C30H27FN2O2S
and a molecular weight of 498.62 g/mol. Its IUPAC name is 9-(benzenesulfonyl)-6-[1-(2-fluorophenyl)ethenyl]-4-pentylpyrido[2,3-b]indole.
Molecular Properties
| Compound Name | 9-(benzenesulfonyl)-6-[1-(2-fluorophenyl)ethenyl]-4-pentylpyrido[2,3-b]indole |
| PubChem CID | 68763110 |
| Molecular Formula | C30H27FN2O2S |
| Molecular Weight | 498.62 g/mol |
| Exact Mass | 498.18 |
| IUPAC Name | 9-(benzenesulfonyl)-6-[1-(2-fluorophenyl)ethenyl]-4-pentylpyrido[2,3-b]indole |
| SMILES | C=C(c1ccc2c(c1)c1c(CCCCC)ccnc1n2S(=O)(=O)c1ccccc1)c1ccccc1F |
| InChI | InChI=1S/C30H27FN2O2S/c1-3-4-6-11-22-18-19-32-30-29(22)26-20-23(21(2)25-14-9-10-15-27(25)31)16-17-28(26)33(30)36(34,35)24-12-7-5-8-13-24/h5,7-10,12-20H,2-4,6,11H2,1H3 |
| InChIKey | KORFJFBIAZSYMC-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 498.62 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 9-(benzenesulfonyl)-6-[1-(2-fluorophenyl)ethenyl]-4-pentylpyrido[2,3-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(benzenesulfonyl)-6-[1-(2-fluorophenyl)ethenyl]-4-pentylpyrido[2,3-b]indole?
The IUPAC name of 9-(benzenesulfonyl)-6-[1-(2-fluorophenyl)ethenyl]-4-pentylpyrido[2,3-b]indole (CID 68763110) is 9-(benzenesulfonyl)-6-[1-(2-fluorophenyl)ethenyl]-4-pentylpyrido[2,3-b]indole.
What is the SMILES notation for 9-(benzenesulfonyl)-6-[1-(2-fluorophenyl)ethenyl]-4-pentylpyrido[2,3-b]indole?
The canonical SMILES for 9-(benzenesulfonyl)-6-[1-(2-fluorophenyl)ethenyl]-4-pentylpyrido[2,3-b]indole is C=C(c1ccc2c(c1)c1c(CCCCC)ccnc1n2S(=O)(=O)c1ccccc1)c1ccccc1F.
What is the InChIKey of 9-(benzenesulfonyl)-6-[1-(2-fluorophenyl)ethenyl]-4-pentylpyrido[2,3-b]indole?
The InChIKey is KORFJFBIAZSYMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H27FN2O2S/c1-3-4-6-11-22-18-19-32-30-29(22)26-20-23(21(2)25-14-9-10-15-27(25)31)16-17-28(26)33(30)36(34,35)24-12-7-5-8-13-24/h5,7-10,12-20H,2-4,6,11H2,1H3.
What are the key properties of 9-(benzenesulfonyl)-6-[1-(2-fluorophenyl)ethenyl]-4-pentylpyrido[2,3-b]indole?
9-(benzenesulfonyl)-6-[1-(2-fluorophenyl)ethenyl]-4-pentylpyrido[2,3-b]indole has a molecular weight of 498.62 g/mol, XLogP of 7.36, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(benzenesulfonyl)-6-[1-(2-fluorophenyl)ethenyl]-4-pentylpyrido[2,3-b]indole is sourced from PubChem (CID 68763110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).