About 1-[(2S)-2-acetamido-3,3-dimethylbutanoyl]pyrrolidine-2-carboxamide
1-[(2S)-2-acetamido-3,3-dimethylbutanoyl]pyrrolidine-2-carboxamide (PubChem CID 68763177) has the molecular formula C13H23N3O3
and a molecular weight of 269.34 g/mol. Its IUPAC name is 1-[(2S)-2-acetamido-3,3-dimethylbutanoyl]pyrrolidine-2-carboxamide.
Molecular Properties
| Compound Name | 1-[(2S)-2-acetamido-3,3-dimethylbutanoyl]pyrrolidine-2-carboxamide |
| PubChem CID | 68763177 |
| Molecular Formula | C13H23N3O3 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.17 |
| IUPAC Name | 1-[(2S)-2-acetamido-3,3-dimethylbutanoyl]pyrrolidine-2-carboxamide |
| SMILES | CC(=O)N[C@H](C(=O)N1CCCC1C(N)=O)C(C)(C)C |
| InChI | InChI=1S/C13H23N3O3/c1-8(17)15-10(13(2,3)4)12(19)16-7-5-6-9(16)11(14)18/h9-10H,5-7H2,1-4H3,(H2,14,18)(H,15,17)/t9?,10-/m1/s1 |
| InChIKey | LACKATSSGLLQSX-QVDQXJPCSA-N |
| XLogP | 0.01 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(2S)-2-acetamido-3,3-dimethylbutanoyl]pyrrolidine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2S)-2-acetamido-3,3-dimethylbutanoyl]pyrrolidine-2-carboxamide?
The IUPAC name of 1-[(2S)-2-acetamido-3,3-dimethylbutanoyl]pyrrolidine-2-carboxamide (CID 68763177) is 1-[(2S)-2-acetamido-3,3-dimethylbutanoyl]pyrrolidine-2-carboxamide.
What is the SMILES notation for 1-[(2S)-2-acetamido-3,3-dimethylbutanoyl]pyrrolidine-2-carboxamide?
The canonical SMILES for 1-[(2S)-2-acetamido-3,3-dimethylbutanoyl]pyrrolidine-2-carboxamide is CC(=O)N[C@H](C(=O)N1CCCC1C(N)=O)C(C)(C)C.
What is the InChIKey of 1-[(2S)-2-acetamido-3,3-dimethylbutanoyl]pyrrolidine-2-carboxamide?
The InChIKey is LACKATSSGLLQSX-QVDQXJPCSA-N. The full InChI is InChI=1S/C13H23N3O3/c1-8(17)15-10(13(2,3)4)12(19)16-7-5-6-9(16)11(14)18/h9-10H,5-7H2,1-4H3,(H2,14,18)(H,15,17)/t9?,10-/m1/s1.
What are the key properties of 1-[(2S)-2-acetamido-3,3-dimethylbutanoyl]pyrrolidine-2-carboxamide?
1-[(2S)-2-acetamido-3,3-dimethylbutanoyl]pyrrolidine-2-carboxamide has a molecular weight of 269.34 g/mol, XLogP of 0.01, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2S)-2-acetamido-3,3-dimethylbutanoyl]pyrrolidine-2-carboxamide is sourced from PubChem (CID 68763177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).