C14H19N7O3 — CID 68763260
(1S,2R,3S,4S,5S)-4-[2-amino-6-(methylamino)purin-9-yl]-2,3-dihydroxy-N-methylbicyclo[3.1.0]hexane-1-carboxamide (PubChem CID 68763260) has the molecular formula C14H19N7O3 and a molecular weight of 333.35 g/mol. Its IUPAC name is (1S,2R,3S,4S,5S)-4-[2-amino-6-(methylamino)purin-9-yl]-2,3-dihydroxy-N-methylbicyclo[3.1.0]hexane-1-carboxamide.
| Compound Name | (1S,2R,3S,4S,5S)-4-[2-amino-6-(methylamino)purin-9-yl]-2,3-dihydroxy-N-methylbicyclo[3.1.0]hexane-1-carboxamide |
|---|---|
| PubChem CID | 68763260 |
| Molecular Formula | C14H19N7O3 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | (1S,2R,3S,4S,5S)-4-[2-amino-6-(methylamino)purin-9-yl]-2,3-dihydroxy-N-methylbicyclo[3.1.0]hexane-1-carboxamide |
| SMILES | CNC(=O)[C@@]12C[C@@H]1[C@H](n1cnc3c(NC)nc(N)nc31)[C@H](O)[C@@H]2O |
| InChI | InChI=1S/C14H19N7O3/c1-16-10-6-11(20-13(15)19-10)21(4-18-6)7-5-3-14(5,12(24)17-2)9(23)8(7)22/h4-5,7-9,22-23H,3H2,1-2H3,(H,17,24)(H3,15,16,19,20)/t5-,7+,8+,9+,14+/m1/s1 |
| InChIKey | WLUDRMVXTPQXJU-XFEFXOKXSA-N |
| XLogP | -1.52 |
| TPSA | 151.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |