About 2,7-dibromo-9,9-dibutyl-10-hexylacridine
2,7-dibromo-9,9-dibutyl-10-hexylacridine (PubChem CID 68763521) has the molecular formula C27H37Br2N
and a molecular weight of 535.41 g/mol. Its IUPAC name is 2,7-dibromo-9,9-dibutyl-10-hexylacridine.
Molecular Properties
| Compound Name | 2,7-dibromo-9,9-dibutyl-10-hexylacridine |
| PubChem CID | 68763521 |
| Molecular Formula | C27H37Br2N |
| Molecular Weight | 535.41 g/mol |
| Exact Mass | 533.13 |
| IUPAC Name | 2,7-dibromo-9,9-dibutyl-10-hexylacridine |
| SMILES | CCCCCCN1c2ccc(Br)cc2C(CCCC)(CCCC)c2cc(Br)ccc21 |
| InChI | InChI=1S/C27H37Br2N/c1-4-7-10-11-18-30-25-14-12-21(28)19-23(25)27(16-8-5-2,17-9-6-3)24-20-22(29)13-15-26(24)30/h12-15,19-20H,4-11,16-18H2,1-3H3 |
| InChIKey | QYNLAZSJPNBCKB-UHFFFAOYSA-N |
| XLogP | 9.91 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 535.41 |
| LogP ≤ 5 | 9.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2,7-dibromo-9,9-dibutyl-10-hexylacridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-dibromo-9,9-dibutyl-10-hexylacridine?
The IUPAC name of 2,7-dibromo-9,9-dibutyl-10-hexylacridine (CID 68763521) is 2,7-dibromo-9,9-dibutyl-10-hexylacridine.
What is the SMILES notation for 2,7-dibromo-9,9-dibutyl-10-hexylacridine?
The canonical SMILES for 2,7-dibromo-9,9-dibutyl-10-hexylacridine is CCCCCCN1c2ccc(Br)cc2C(CCCC)(CCCC)c2cc(Br)ccc21.
What is the InChIKey of 2,7-dibromo-9,9-dibutyl-10-hexylacridine?
The InChIKey is QYNLAZSJPNBCKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H37Br2N/c1-4-7-10-11-18-30-25-14-12-21(28)19-23(25)27(16-8-5-2,17-9-6-3)24-20-22(29)13-15-26(24)30/h12-15,19-20H,4-11,16-18H2,1-3H3.
What are the key properties of 2,7-dibromo-9,9-dibutyl-10-hexylacridine?
2,7-dibromo-9,9-dibutyl-10-hexylacridine has a molecular weight of 535.41 g/mol, XLogP of 9.91, 11 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-dibromo-9,9-dibutyl-10-hexylacridine is sourced from PubChem (CID 68763521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).