About 6-ethyl-1,2-dihydropyridine-5-carboxamide
6-ethyl-1,2-dihydropyridine-5-carboxamide (PubChem CID 68763744) has the molecular formula C8H12N2O
and a molecular weight of 152.20 g/mol. Its IUPAC name is 6-ethyl-1,2-dihydropyridine-5-carboxamide.
Molecular Properties
| Compound Name | 6-ethyl-1,2-dihydropyridine-5-carboxamide |
| PubChem CID | 68763744 |
| Molecular Formula | C8H12N2O |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.09 |
| IUPAC Name | 6-ethyl-1,2-dihydropyridine-5-carboxamide |
| SMILES | CCC1=C(C(N)=O)C=CCN1 |
| InChI | InChI=1S/C8H12N2O/c1-2-7-6(8(9)11)4-3-5-10-7/h3-4,10H,2,5H2,1H3,(H2,9,11) |
| InChIKey | OAGJUVNSAIZHFF-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-ethyl-1,2-dihydropyridine-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-1,2-dihydropyridine-5-carboxamide?
The IUPAC name of 6-ethyl-1,2-dihydropyridine-5-carboxamide (CID 68763744) is 6-ethyl-1,2-dihydropyridine-5-carboxamide.
What is the SMILES notation for 6-ethyl-1,2-dihydropyridine-5-carboxamide?
The canonical SMILES for 6-ethyl-1,2-dihydropyridine-5-carboxamide is CCC1=C(C(N)=O)C=CCN1.
What is the InChIKey of 6-ethyl-1,2-dihydropyridine-5-carboxamide?
The InChIKey is OAGJUVNSAIZHFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O/c1-2-7-6(8(9)11)4-3-5-10-7/h3-4,10H,2,5H2,1H3,(H2,9,11).
What are the key properties of 6-ethyl-1,2-dihydropyridine-5-carboxamide?
6-ethyl-1,2-dihydropyridine-5-carboxamide has a molecular weight of 152.20 g/mol, XLogP of 0.30, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-1,2-dihydropyridine-5-carboxamide is sourced from PubChem (CID 68763744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).