C22H17F3N4O4S — CID 68763891
4-[(5-aminoquinolin-4-yl)methyl]-6-[4-(trifluoromethylsulfonyl)phenyl]-4,6-diazaspiro[2.4]heptane-5,7-dione (PubChem CID 68763891) has the molecular formula C22H17F3N4O4S and a molecular weight of 490.46 g/mol. Its IUPAC name is 4-[(5-aminoquinolin-4-yl)methyl]-6-[4-(trifluoromethylsulfonyl)phenyl]-4,6-diazaspiro[2.4]heptane-5,7-dione.
| Compound Name | 4-[(5-aminoquinolin-4-yl)methyl]-6-[4-(trifluoromethylsulfonyl)phenyl]-4,6-diazaspiro[2.4]heptane-5,7-dione |
|---|---|
| PubChem CID | 68763891 |
| Molecular Formula | C22H17F3N4O4S |
| Molecular Weight | 490.46 g/mol |
| Exact Mass | 490.09 |
| IUPAC Name | 4-[(5-aminoquinolin-4-yl)methyl]-6-[4-(trifluoromethylsulfonyl)phenyl]-4,6-diazaspiro[2.4]heptane-5,7-dione |
| SMILES | Nc1cccc2nccc(CN3C(=O)N(c4ccc(S(=O)(=O)C(F)(F)F)cc4)C(=O)C34CC4)c12 |
| InChI | InChI=1S/C22H17F3N4O4S/c23-22(24,25)34(32,33)15-6-4-14(5-7-15)29-19(30)21(9-10-21)28(20(29)31)12-13-8-11-27-17-3-1-2-16(26)18(13)17/h1-8,11H,9-10,12,26H2 |
| InChIKey | HABXALAVJBYGCY-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 113.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.46 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|