C21H20F3N3O5 — CID 68763904
tert-butyl 4-[[2,4-dioxo-3-[4-(trifluoromethoxy)phenyl]imidazolidin-1-yl]methyl]pyridine-2-carboxylate (PubChem CID 68763904) has the molecular formula C21H20F3N3O5 and a molecular weight of 451.40 g/mol. Its IUPAC name is tert-butyl 4-[[2,4-dioxo-3-[4-(trifluoromethoxy)phenyl]imidazolidin-1-yl]methyl]pyridine-2-carboxylate.
| Compound Name | tert-butyl 4-[[2,4-dioxo-3-[4-(trifluoromethoxy)phenyl]imidazolidin-1-yl]methyl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 68763904 |
| Molecular Formula | C21H20F3N3O5 |
| Molecular Weight | 451.40 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | tert-butyl 4-[[2,4-dioxo-3-[4-(trifluoromethoxy)phenyl]imidazolidin-1-yl]methyl]pyridine-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1cc(CN2CC(=O)N(c3ccc(OC(F)(F)F)cc3)C2=O)ccn1 |
| InChI | InChI=1S/C21H20F3N3O5/c1-20(2,3)32-18(29)16-10-13(8-9-25-16)11-26-12-17(28)27(19(26)30)14-4-6-15(7-5-14)31-21(22,23)24/h4-10H,11-12H2,1-3H3 |
| InChIKey | YTGCBZNKBXNCMP-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 89.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.40 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|