C17H19BrO5 — CID 68764417
2-[(3aR,5R,6R,6aR)-5-[2-(4-bromophenyl)ethenyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]acetic acid (PubChem CID 68764417) has the molecular formula C17H19BrO5 and a molecular weight of 383.24 g/mol. Its IUPAC name is 2-[(3aR,5R,6R,6aR)-5-[2-(4-bromophenyl)ethenyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]acetic acid.
| Compound Name | 2-[(3aR,5R,6R,6aR)-5-[2-(4-bromophenyl)ethenyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]acetic acid |
|---|---|
| PubChem CID | 68764417 |
| Molecular Formula | C17H19BrO5 |
| Molecular Weight | 383.24 g/mol |
| Exact Mass | 382.04 |
| IUPAC Name | 2-[(3aR,5R,6R,6aR)-5-[2-(4-bromophenyl)ethenyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]acetic acid |
| SMILES | CC1(C)O[C@H]2O[C@H](C=Cc3ccc(Br)cc3)[C@@H](CC(=O)O)[C@H]2O1 |
| InChI | InChI=1S/C17H19BrO5/c1-17(2)22-15-12(9-14(19)20)13(21-16(15)23-17)8-5-10-3-6-11(18)7-4-10/h3-8,12-13,15-16H,9H2,1-2H3,(H,19,20)/t12-,13-,15-,16-/m1/s1 |
| InChIKey | RNBUTGURFXMRBH-RRCSTGOVSA-N |
| XLogP | 3.43 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.24 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |