C36H35ClF3N7O6S2 — CID 68764532
2-[4-[2-[[2-(4-chlorophenyl)-1,3-thiazol-4-yl]methylsulfanyl]-3,5-dicyano-6-(propylamino)-4-pyridinyl]phenoxy]ethyl (2S)-2-(3-aminopropanoylamino)propanoate;2,2,2-trifluoroacetic acid (PubChem CID 68764532) has the molecular formula C36H35ClF3N7O6S2 and a molecular weight of 818.30 g/mol. Its IUPAC name is 2-[4-[2-[[2-(4-chlorophenyl)-1,3-thiazol-4-yl]methylsulfanyl]-3,5-dicyano-6-(propylamino)-4-pyridinyl]phenoxy]ethyl (2S)-2-(3-aminopropanoylamino)propanoate;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[4-[2-[[2-(4-chlorophenyl)-1,3-thiazol-4-yl]methylsulfanyl]-3,5-dicyano-6-(propylamino)-4-pyridinyl]phenoxy]ethyl (2S)-2-(3-aminopropanoylamino)propanoate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 68764532 |
| Molecular Formula | C36H35ClF3N7O6S2 |
| Molecular Weight | 818.30 g/mol |
| Exact Mass | 817.17 |
| IUPAC Name | 2-[4-[2-[[2-(4-chlorophenyl)-1,3-thiazol-4-yl]methylsulfanyl]-3,5-dicyano-6-(propylamino)-4-pyridinyl]phenoxy]ethyl (2S)-2-(3-aminopropanoylamino)propanoate;2,2,2-trifluoroacetic acid |
| SMILES | CCCNc1nc(SCc2csc(-c3ccc(Cl)cc3)n2)c(C#N)c(-c2ccc(OCCOC(=O)[C@H](C)NC(=O)CCN)cc2)c1C#N.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C34H34ClN7O4S2.C2HF3O2/c1-3-14-39-31-27(17-37)30(22-6-10-26(11-7-22)45-15-16-46-34(44)21(2)40-29(43)12-13-36)28(18-38)33(42-31)48-20-25-19-47-32(41-25)23-4-8-24(35)9-5-23;3-2(4,5)1(6)7/h4-11,19,21H,3,12-16,20,36H2,1-2H3,(H,39,42)(H,40,43);(H,6,7)/t21-;/m0./s1 |
| InChIKey | MGKISORHXFUBCM-BOXHHOBZSA-N |
| XLogP | 6.79 |
| TPSA | 213.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 818.30 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|