About azane;(3S)-5-imidazo[1,2-a]pyridin-6-yl-3,4-dihydro-2H-chromen-3-amine
azane;(3S)-5-imidazo[1,2-a]pyridin-6-yl-3,4-dihydro-2H-chromen-3-amine (PubChem CID 68764787) has the molecular formula C16H18N4O
and a molecular weight of 282.35 g/mol. Its IUPAC name is azane;(3S)-5-imidazo[1,2-a]pyridin-6-yl-3,4-dihydro-2H-chromen-3-amine.
Molecular Properties
| Compound Name | azane;(3S)-5-imidazo[1,2-a]pyridin-6-yl-3,4-dihydro-2H-chromen-3-amine |
| PubChem CID | 68764787 |
| Molecular Formula | C16H18N4O |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | azane;(3S)-5-imidazo[1,2-a]pyridin-6-yl-3,4-dihydro-2H-chromen-3-amine |
| SMILES | N.N[C@@H]1COc2cccc(-c3ccc4nccn4c3)c2C1 |
| InChI | InChI=1S/C16H15N3O.H3N/c17-12-8-14-13(2-1-3-15(14)20-10-12)11-4-5-16-18-6-7-19(16)9-11;/h1-7,9,12H,8,10,17H2;1H3/t12-;/m0./s1 |
| InChIKey | HEDUYGYHPYPMCQ-YDALLXLXSA-N |
| XLogP | 2.43 |
| TPSA | 87.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze azane;(3S)-5-imidazo[1,2-a]pyridin-6-yl-3,4-dihydro-2H-chromen-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;(3S)-5-imidazo[1,2-a]pyridin-6-yl-3,4-dihydro-2H-chromen-3-amine?
The IUPAC name of azane;(3S)-5-imidazo[1,2-a]pyridin-6-yl-3,4-dihydro-2H-chromen-3-amine (CID 68764787) is azane;(3S)-5-imidazo[1,2-a]pyridin-6-yl-3,4-dihydro-2H-chromen-3-amine.
What is the SMILES notation for azane;(3S)-5-imidazo[1,2-a]pyridin-6-yl-3,4-dihydro-2H-chromen-3-amine?
The canonical SMILES for azane;(3S)-5-imidazo[1,2-a]pyridin-6-yl-3,4-dihydro-2H-chromen-3-amine is N.N[C@@H]1COc2cccc(-c3ccc4nccn4c3)c2C1.
What is the InChIKey of azane;(3S)-5-imidazo[1,2-a]pyridin-6-yl-3,4-dihydro-2H-chromen-3-amine?
The InChIKey is HEDUYGYHPYPMCQ-YDALLXLXSA-N. The full InChI is InChI=1S/C16H15N3O.H3N/c17-12-8-14-13(2-1-3-15(14)20-10-12)11-4-5-16-18-6-7-19(16)9-11;/h1-7,9,12H,8,10,17H2;1H3/t12-;/m0./s1.
What are the key properties of azane;(3S)-5-imidazo[1,2-a]pyridin-6-yl-3,4-dihydro-2H-chromen-3-amine?
azane;(3S)-5-imidazo[1,2-a]pyridin-6-yl-3,4-dihydro-2H-chromen-3-amine has a molecular weight of 282.35 g/mol, XLogP of 2.43, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for azane;(3S)-5-imidazo[1,2-a]pyridin-6-yl-3,4-dihydro-2H-chromen-3-amine is sourced from PubChem (CID 68764787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).