About 4-hexylimino-5,5-dipentyloxolan-2-one
4-hexylimino-5,5-dipentyloxolan-2-one (PubChem CID 68764954) has the molecular formula C20H37NO2
and a molecular weight of 323.52 g/mol. Its IUPAC name is 4-hexylimino-5,5-dipentyloxolan-2-one.
Molecular Properties
| Compound Name | 4-hexylimino-5,5-dipentyloxolan-2-one |
| PubChem CID | 68764954 |
| Molecular Formula | C20H37NO2 |
| Molecular Weight | 323.52 g/mol |
| Exact Mass | 323.28 |
| IUPAC Name | 4-hexylimino-5,5-dipentyloxolan-2-one |
| SMILES | CCCCCC/N=C1\CC(=O)OC1(CCCCC)CCCCC |
| InChI | InChI=1S/C20H37NO2/c1-4-7-10-13-16-21-18-17-19(22)23-20(18,14-11-8-5-2)15-12-9-6-3/h4-17H2,1-3H3/b21-18+ |
| InChIKey | OKCQTGIMBOBCQG-DYTRJAOYSA-N |
| XLogP | 5.85 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 323.52 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-hexylimino-5,5-dipentyloxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hexylimino-5,5-dipentyloxolan-2-one?
The IUPAC name of 4-hexylimino-5,5-dipentyloxolan-2-one (CID 68764954) is 4-hexylimino-5,5-dipentyloxolan-2-one.
What is the SMILES notation for 4-hexylimino-5,5-dipentyloxolan-2-one?
The canonical SMILES for 4-hexylimino-5,5-dipentyloxolan-2-one is CCCCCC/N=C1\CC(=O)OC1(CCCCC)CCCCC.
What is the InChIKey of 4-hexylimino-5,5-dipentyloxolan-2-one?
The InChIKey is OKCQTGIMBOBCQG-DYTRJAOYSA-N. The full InChI is InChI=1S/C20H37NO2/c1-4-7-10-13-16-21-18-17-19(22)23-20(18,14-11-8-5-2)15-12-9-6-3/h4-17H2,1-3H3/b21-18+.
What are the key properties of 4-hexylimino-5,5-dipentyloxolan-2-one?
4-hexylimino-5,5-dipentyloxolan-2-one has a molecular weight of 323.52 g/mol, XLogP of 5.85, 13 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hexylimino-5,5-dipentyloxolan-2-one is sourced from PubChem (CID 68764954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).