C21H20ClN3O3S2 — CID 6876519
2-[(4-chlorophenyl)sulfonyl-[(3-methylphenyl)methyl]amino]-N-[(E)-thiophen-2-ylmethylideneamino]acetamide (PubChem CID 6876519) has the molecular formula C21H20ClN3O3S2 and a molecular weight of 462.00 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)sulfonyl-[(3-methylphenyl)methyl]amino]-N-[(E)-thiophen-2-ylmethylideneamino]acetamide.
| Compound Name | 2-[(4-chlorophenyl)sulfonyl-[(3-methylphenyl)methyl]amino]-N-[(E)-thiophen-2-ylmethylideneamino]acetamide |
|---|---|
| PubChem CID | 6876519 |
| Molecular Formula | C21H20ClN3O3S2 |
| Molecular Weight | 462.00 g/mol |
| Exact Mass | 461.06 |
| IUPAC Name | 2-[(4-chlorophenyl)sulfonyl-[(3-methylphenyl)methyl]amino]-N-[(E)-thiophen-2-ylmethylideneamino]acetamide |
| SMILES | Cc1cccc(CN(CC(=O)N/N=C/c2cccs2)S(=O)(=O)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C21H20ClN3O3S2/c1-16-4-2-5-17(12-16)14-25(30(27,28)20-9-7-18(22)8-10-20)15-21(26)24-23-13-19-6-3-11-29-19/h2-13H,14-15H2,1H3,(H,24,26)/b23-13+ |
| InChIKey | WEAOIXXVZNSDMZ-YDZHTSKRSA-N |
| XLogP | 4.05 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.00 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|