C9H23N3O3 — CID 68765556
N,N',N'-trimethylpiperidine-1-carbohydrazide;dihydrate (PubChem CID 68765556) has the molecular formula C9H23N3O3 and a molecular weight of 221.30 g/mol. Its IUPAC name is N,N',N'-trimethylpiperidine-1-carbohydrazide;dihydrate.
| Compound Name | N,N',N'-trimethylpiperidine-1-carbohydrazide;dihydrate |
|---|---|
| PubChem CID | 68765556 |
| Molecular Formula | C9H23N3O3 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.17 |
| IUPAC Name | N,N',N'-trimethylpiperidine-1-carbohydrazide;dihydrate |
| SMILES | CN(C)N(C)C(=O)N1CCCCC1.O.O |
| InChI | InChI=1S/C9H19N3O.2H2O/c1-10(2)11(3)9(13)12-7-5-4-6-8-12;;/h4-8H2,1-3H3;2*1H2 |
| InChIKey | XGYOOHVSDVRDTO-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 89.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|