C22H20F3NO5 — CID 68765654
2-[4-(difluoromethoxy)-8-fluoro-3-[(4-methoxyphenyl)methyl]quinolin-5-yl]oxybutanoic acid (PubChem CID 68765654) has the molecular formula C22H20F3NO5 and a molecular weight of 435.40 g/mol. Its IUPAC name is 2-[4-(difluoromethoxy)-8-fluoro-3-[(4-methoxyphenyl)methyl]quinolin-5-yl]oxybutanoic acid.
| Compound Name | 2-[4-(difluoromethoxy)-8-fluoro-3-[(4-methoxyphenyl)methyl]quinolin-5-yl]oxybutanoic acid |
|---|---|
| PubChem CID | 68765654 |
| Molecular Formula | C22H20F3NO5 |
| Molecular Weight | 435.40 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | 2-[4-(difluoromethoxy)-8-fluoro-3-[(4-methoxyphenyl)methyl]quinolin-5-yl]oxybutanoic acid |
| SMILES | CCC(Oc1ccc(F)c2ncc(Cc3ccc(OC)cc3)c(OC(F)F)c12)C(=O)O |
| InChI | InChI=1S/C22H20F3NO5/c1-3-16(21(27)28)30-17-9-8-15(23)19-18(17)20(31-22(24)25)13(11-26-19)10-12-4-6-14(29-2)7-5-12/h4-9,11,16,22H,3,10H2,1-2H3,(H,27,28) |
| InChIKey | HYGFUHZSFYLEMG-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.40 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |