About 3-[2-(2,4-dichloroanilino)-7-(diethylamino)benzimidazol-1-yl]propanoic acid
3-[2-(2,4-dichloroanilino)-7-(diethylamino)benzimidazol-1-yl]propanoic acid (PubChem CID 68766365) has the molecular formula C20H22Cl2N4O2
and a molecular weight of 421.33 g/mol. Its IUPAC name is 3-[2-(2,4-dichloroanilino)-7-(diethylamino)benzimidazol-1-yl]propanoic acid.
Molecular Properties
| Compound Name | 3-[2-(2,4-dichloroanilino)-7-(diethylamino)benzimidazol-1-yl]propanoic acid |
| PubChem CID | 68766365 |
| Molecular Formula | C20H22Cl2N4O2 |
| Molecular Weight | 421.33 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | 3-[2-(2,4-dichloroanilino)-7-(diethylamino)benzimidazol-1-yl]propanoic acid |
| SMILES | CCN(CC)c1cccc2nc(Nc3ccc(Cl)cc3Cl)n(CCC(=O)O)c12 |
| InChI | InChI=1S/C20H22Cl2N4O2/c1-3-25(4-2)17-7-5-6-16-19(17)26(11-10-18(27)28)20(24-16)23-15-9-8-13(21)12-14(15)22/h5-9,12H,3-4,10-11H2,1-2H3,(H,23,24)(H,27,28) |
| InChIKey | BNEWMHAQKFZIFC-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 421.33 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[2-(2,4-dichloroanilino)-7-(diethylamino)benzimidazol-1-yl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(2,4-dichloroanilino)-7-(diethylamino)benzimidazol-1-yl]propanoic acid?
The IUPAC name of 3-[2-(2,4-dichloroanilino)-7-(diethylamino)benzimidazol-1-yl]propanoic acid (CID 68766365) is 3-[2-(2,4-dichloroanilino)-7-(diethylamino)benzimidazol-1-yl]propanoic acid.
What is the SMILES notation for 3-[2-(2,4-dichloroanilino)-7-(diethylamino)benzimidazol-1-yl]propanoic acid?
The canonical SMILES for 3-[2-(2,4-dichloroanilino)-7-(diethylamino)benzimidazol-1-yl]propanoic acid is CCN(CC)c1cccc2nc(Nc3ccc(Cl)cc3Cl)n(CCC(=O)O)c12.
What is the InChIKey of 3-[2-(2,4-dichloroanilino)-7-(diethylamino)benzimidazol-1-yl]propanoic acid?
The InChIKey is BNEWMHAQKFZIFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22Cl2N4O2/c1-3-25(4-2)17-7-5-6-16-19(17)26(11-10-18(27)28)20(24-16)23-15-9-8-13(21)12-14(15)22/h5-9,12H,3-4,10-11H2,1-2H3,(H,23,24)(H,27,28).
What are the key properties of 3-[2-(2,4-dichloroanilino)-7-(diethylamino)benzimidazol-1-yl]propanoic acid?
3-[2-(2,4-dichloroanilino)-7-(diethylamino)benzimidazol-1-yl]propanoic acid has a molecular weight of 421.33 g/mol, XLogP of 5.41, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(2,4-dichloroanilino)-7-(diethylamino)benzimidazol-1-yl]propanoic acid is sourced from PubChem (CID 68766365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).