About zinc bis(2-[2-(2,5-dihydroxyphenyl)ethylideneamino]acetate)
zinc bis(2-[2-(2,5-dihydroxyphenyl)ethylideneamino]acetate) (PubChem CID 68766995) has the molecular formula C20H20N2O8Zn
and a molecular weight of 481.78 g/mol. Its IUPAC name is zinc bis(2-[2-(2,5-dihydroxyphenyl)ethylideneamino]acetate).
Molecular Properties
| Compound Name | zinc bis(2-[2-(2,5-dihydroxyphenyl)ethylideneamino]acetate) |
| PubChem CID | 68766995 |
| Molecular Formula | C20H20N2O8Zn |
| Molecular Weight | 481.78 g/mol |
| Exact Mass | 480.05 |
| IUPAC Name | zinc bis(2-[2-(2,5-dihydroxyphenyl)ethylideneamino]acetate) |
| SMILES | O=C([O-])C/N=C/Cc1cc(O)ccc1O.O=C([O-])C/N=C/Cc1cc(O)ccc1O.[Zn+2] |
| InChI | InChI=1S/2C10H11NO4.Zn/c2*12-8-1-2-9(13)7(5-8)3-4-11-6-10(14)15;/h2*1-2,4-5,12-13H,3,6H2,(H,14,15);/q;;+2/p-2/b2*11-4+; |
| InChIKey | PECNLSQGGMYDLZ-MEKCNCLGSA-L |
| XLogP | -1.08 |
| TPSA | 185.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 481.78 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze zinc bis(2-[2-(2,5-dihydroxyphenyl)ethylideneamino]acetate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc bis(2-[2-(2,5-dihydroxyphenyl)ethylideneamino]acetate)?
The IUPAC name of zinc bis(2-[2-(2,5-dihydroxyphenyl)ethylideneamino]acetate) (CID 68766995) is zinc bis(2-[2-(2,5-dihydroxyphenyl)ethylideneamino]acetate).
What is the SMILES notation for zinc bis(2-[2-(2,5-dihydroxyphenyl)ethylideneamino]acetate)?
The canonical SMILES for zinc bis(2-[2-(2,5-dihydroxyphenyl)ethylideneamino]acetate) is O=C([O-])C/N=C/Cc1cc(O)ccc1O.O=C([O-])C/N=C/Cc1cc(O)ccc1O.[Zn+2].
What is the InChIKey of zinc bis(2-[2-(2,5-dihydroxyphenyl)ethylideneamino]acetate)?
The InChIKey is PECNLSQGGMYDLZ-MEKCNCLGSA-L. The full InChI is InChI=1S/2C10H11NO4.Zn/c2*12-8-1-2-9(13)7(5-8)3-4-11-6-10(14)15;/h2*1-2,4-5,12-13H,3,6H2,(H,14,15);/q;;+2/p-2/b2*11-4+;.
What are the key properties of zinc bis(2-[2-(2,5-dihydroxyphenyl)ethylideneamino]acetate)?
zinc bis(2-[2-(2,5-dihydroxyphenyl)ethylideneamino]acetate) has a molecular weight of 481.78 g/mol, XLogP of -1.08, 8 rotatable bonds, 4 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for zinc bis(2-[2-(2,5-dihydroxyphenyl)ethylideneamino]acetate) is sourced from PubChem (CID 68766995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).