About 7-(2-bromophenyl)-3-methyl-4H-pyrido[2,3-d]pyrimidine-2,4-diamine
7-(2-bromophenyl)-3-methyl-4H-pyrido[2,3-d]pyrimidine-2,4-diamine (PubChem CID 68767884) has the molecular formula C14H14BrN5
and a molecular weight of 332.21 g/mol. Its IUPAC name is 7-(2-bromophenyl)-3-methyl-4H-pyrido[2,3-d]pyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 7-(2-bromophenyl)-3-methyl-4H-pyrido[2,3-d]pyrimidine-2,4-diamine |
| PubChem CID | 68767884 |
| Molecular Formula | C14H14BrN5 |
| Molecular Weight | 332.21 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | 7-(2-bromophenyl)-3-methyl-4H-pyrido[2,3-d]pyrimidine-2,4-diamine |
| SMILES | CN1C(N)=Nc2nc(-c3ccccc3Br)ccc2C1N |
| InChI | InChI=1S/C14H14BrN5/c1-20-12(16)9-6-7-11(18-13(9)19-14(20)17)8-4-2-3-5-10(8)15/h2-7,12H,16H2,1H3,(H2,17,18,19) |
| InChIKey | HWUHAGWSUWDBKP-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 80.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.21 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-(2-bromophenyl)-3-methyl-4H-pyrido[2,3-d]pyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(2-bromophenyl)-3-methyl-4H-pyrido[2,3-d]pyrimidine-2,4-diamine?
The IUPAC name of 7-(2-bromophenyl)-3-methyl-4H-pyrido[2,3-d]pyrimidine-2,4-diamine (CID 68767884) is 7-(2-bromophenyl)-3-methyl-4H-pyrido[2,3-d]pyrimidine-2,4-diamine.
What is the SMILES notation for 7-(2-bromophenyl)-3-methyl-4H-pyrido[2,3-d]pyrimidine-2,4-diamine?
The canonical SMILES for 7-(2-bromophenyl)-3-methyl-4H-pyrido[2,3-d]pyrimidine-2,4-diamine is CN1C(N)=Nc2nc(-c3ccccc3Br)ccc2C1N.
What is the InChIKey of 7-(2-bromophenyl)-3-methyl-4H-pyrido[2,3-d]pyrimidine-2,4-diamine?
The InChIKey is HWUHAGWSUWDBKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14BrN5/c1-20-12(16)9-6-7-11(18-13(9)19-14(20)17)8-4-2-3-5-10(8)15/h2-7,12H,16H2,1H3,(H2,17,18,19).
What are the key properties of 7-(2-bromophenyl)-3-methyl-4H-pyrido[2,3-d]pyrimidine-2,4-diamine?
7-(2-bromophenyl)-3-methyl-4H-pyrido[2,3-d]pyrimidine-2,4-diamine has a molecular weight of 332.21 g/mol, XLogP of 2.36, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(2-bromophenyl)-3-methyl-4H-pyrido[2,3-d]pyrimidine-2,4-diamine is sourced from PubChem (CID 68767884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).