About CID 68767970
CID 68767970 (PubChem CID 68767970) has the molecular formula C11H16ClSi
and a molecular weight of 211.79 g/mol.
Molecular Properties
| Compound Name | CID 68767970 |
| PubChem CID | 68767970 |
| Molecular Formula | C11H16ClSi |
| Molecular Weight | 211.79 g/mol |
| Exact Mass | 211.07 |
| IUPAC Name | — |
| SMILES | C[Si](C)CCc1cccc(CCl)c1 |
| InChI | InChI=1S/C11H16ClSi/c1-13(2)7-6-10-4-3-5-11(8-10)9-12/h3-5,8H,6-7,9H2,1-2H3 |
| InChIKey | ZPVMJQRVSHZYNT-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.79 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 68767970 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 68767970?
The IUPAC name of CID 68767970 (CID 68767970) is not available.
What is the SMILES notation for CID 68767970?
The canonical SMILES for CID 68767970 is C[Si](C)CCc1cccc(CCl)c1.
What is the InChIKey of CID 68767970?
The InChIKey is ZPVMJQRVSHZYNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16ClSi/c1-13(2)7-6-10-4-3-5-11(8-10)9-12/h3-5,8H,6-7,9H2,1-2H3.
What are the key properties of CID 68767970?
CID 68767970 has a molecular weight of 211.79 g/mol, XLogP of 3.72, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 68767970 is sourced from PubChem (CID 68767970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).