C12H16MnN6O4 — CID 68767985
bis((2S)-2-amino-3-(1H-imidazol-5-yl)propanoate);manganese(2+) (PubChem CID 68767985) has the molecular formula C12H16MnN6O4 and a molecular weight of 363.24 g/mol. Its IUPAC name is bis((2S)-2-amino-3-(1H-imidazol-5-yl)propanoate);manganese(2+).
| Compound Name | bis((2S)-2-amino-3-(1H-imidazol-5-yl)propanoate);manganese(2+) |
|---|---|
| PubChem CID | 68767985 |
| Molecular Formula | C12H16MnN6O4 |
| Molecular Weight | 363.24 g/mol |
| Exact Mass | 363.06 |
| IUPAC Name | bis((2S)-2-amino-3-(1H-imidazol-5-yl)propanoate);manganese(2+) |
| SMILES | N[C@@H](Cc1cnc[nH]1)C(=O)[O-].N[C@@H](Cc1cnc[nH]1)C(=O)[O-].[Mn+2] |
| InChI | InChI=1S/2C6H9N3O2.Mn/c2*7-5(6(10)11)1-4-2-8-3-9-4;/h2*2-3,5H,1,7H2,(H,8,9)(H,10,11);/q;;+2/p-2/t2*5-;/m00./s1 |
| InChIKey | SYAGMRROGWOKPH-MDTVQASCSA-L |
| XLogP | -3.94 |
| TPSA | 189.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.24 |
| LogP ≤ 5 | -3.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |