C20H31NO — CID 68768724
1,2,2,6,6-pentakis(prop-2-enyl)piperidin-4-ol (PubChem CID 68768724) has the molecular formula C20H31NO and a molecular weight of 301.47 g/mol. Its IUPAC name is 1,2,2,6,6-pentakis(prop-2-enyl)piperidin-4-ol.
| Compound Name | 1,2,2,6,6-pentakis(prop-2-enyl)piperidin-4-ol |
|---|---|
| PubChem CID | 68768724 |
| Molecular Formula | C20H31NO |
| Molecular Weight | 301.47 g/mol |
| Exact Mass | 301.24 |
| IUPAC Name | 1,2,2,6,6-pentakis(prop-2-enyl)piperidin-4-ol |
| SMILES | C=CCN1C(CC=C)(CC=C)CC(O)CC1(CC=C)CC=C |
| InChI | InChI=1S/C20H31NO/c1-6-11-19(12-7-2)16-18(22)17-20(13-8-3,14-9-4)21(19)15-10-5/h6-10,18,22H,1-5,11-17H2 |
| InChIKey | UXZKFLOWMZQEDS-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.47 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|