C16H23N3O2 — CID 68768738
2-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-2-pyridin-3-ylbutanoic acid (PubChem CID 68768738) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is 2-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-2-pyridin-3-ylbutanoic acid.
| Compound Name | 2-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-2-pyridin-3-ylbutanoic acid |
|---|---|
| PubChem CID | 68768738 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | 2-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-2-pyridin-3-ylbutanoic acid |
| SMILES | CCC(C(=O)O)(c1cccnc1)N1CCN2CCC[C@H]2C1 |
| InChI | InChI=1S/C16H23N3O2/c1-2-16(15(20)21,13-5-3-7-17-11-13)19-10-9-18-8-4-6-14(18)12-19/h3,5,7,11,14H,2,4,6,8-10,12H2,1H3,(H,20,21)/t14-,16?/m0/s1 |
| InChIKey | DORIENYNZSDJDU-LBAUFKAWSA-N |
| XLogP | 1.55 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |