About N-[(E)-(2,3-dimethoxyphenyl)methylideneamino]-2,4-dihydroxybenzamide
N-[(E)-(2,3-dimethoxyphenyl)methylideneamino]-2,4-dihydroxybenzamide (PubChem CID 6876930) has the molecular formula C16H16N2O5
and a molecular weight of 316.31 g/mol. Its IUPAC name is N-[(E)-(2,3-dimethoxyphenyl)methylideneamino]-2,4-dihydroxybenzamide.
Molecular Properties
| Compound Name | N-[(E)-(2,3-dimethoxyphenyl)methylideneamino]-2,4-dihydroxybenzamide |
| PubChem CID | 6876930 |
| Molecular Formula | C16H16N2O5 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | N-[(E)-(2,3-dimethoxyphenyl)methylideneamino]-2,4-dihydroxybenzamide |
| SMILES | COc1cccc(/C=N/NC(=O)c2ccc(O)cc2O)c1OC |
| InChI | InChI=1S/C16H16N2O5/c1-22-14-5-3-4-10(15(14)23-2)9-17-18-16(21)12-7-6-11(19)8-13(12)20/h3-9,19-20H,1-2H3,(H,18,21)/b17-9+ |
| InChIKey | SBCSSMKMZLZJBZ-RQZCQDPDSA-N |
| XLogP | 1.88 |
| TPSA | 100.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(E)-(2,3-dimethoxyphenyl)methylideneamino]-2,4-dihydroxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-(2,3-dimethoxyphenyl)methylideneamino]-2,4-dihydroxybenzamide?
The IUPAC name of N-[(E)-(2,3-dimethoxyphenyl)methylideneamino]-2,4-dihydroxybenzamide (CID 6876930) is N-[(E)-(2,3-dimethoxyphenyl)methylideneamino]-2,4-dihydroxybenzamide.
What is the SMILES notation for N-[(E)-(2,3-dimethoxyphenyl)methylideneamino]-2,4-dihydroxybenzamide?
The canonical SMILES for N-[(E)-(2,3-dimethoxyphenyl)methylideneamino]-2,4-dihydroxybenzamide is COc1cccc(/C=N/NC(=O)c2ccc(O)cc2O)c1OC.
What is the InChIKey of N-[(E)-(2,3-dimethoxyphenyl)methylideneamino]-2,4-dihydroxybenzamide?
The InChIKey is SBCSSMKMZLZJBZ-RQZCQDPDSA-N. The full InChI is InChI=1S/C16H16N2O5/c1-22-14-5-3-4-10(15(14)23-2)9-17-18-16(21)12-7-6-11(19)8-13(12)20/h3-9,19-20H,1-2H3,(H,18,21)/b17-9+.
What are the key properties of N-[(E)-(2,3-dimethoxyphenyl)methylideneamino]-2,4-dihydroxybenzamide?
N-[(E)-(2,3-dimethoxyphenyl)methylideneamino]-2,4-dihydroxybenzamide has a molecular weight of 316.31 g/mol, XLogP of 1.88, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-(2,3-dimethoxyphenyl)methylideneamino]-2,4-dihydroxybenzamide is sourced from PubChem (CID 6876930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).