C12H14ClNO2S — CID 68769670
methyl 2-amino-3-(1-benzothiophen-3-yl)propanoate;hydrochloride (PubChem CID 68769670) has the molecular formula C12H14ClNO2S and a molecular weight of 271.77 g/mol. Its IUPAC name is methyl 2-amino-3-(1-benzothiophen-3-yl)propanoate;hydrochloride.
| Compound Name | methyl 2-amino-3-(1-benzothiophen-3-yl)propanoate;hydrochloride |
|---|---|
| PubChem CID | 68769670 |
| Molecular Formula | C12H14ClNO2S |
| Molecular Weight | 271.77 g/mol |
| Exact Mass | 271.04 |
| IUPAC Name | methyl 2-amino-3-(1-benzothiophen-3-yl)propanoate;hydrochloride |
| SMILES | COC(=O)C(N)Cc1csc2ccccc12.Cl |
| InChI | InChI=1S/C12H13NO2S.ClH/c1-15-12(14)10(13)6-8-7-16-11-5-3-2-4-9(8)11;/h2-5,7,10H,6,13H2,1H3;1H |
| InChIKey | TYGSGLAVLYKRMT-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.77 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |