About ethyl 2-aminobenzoate
ethyl 2-aminobenzoate (PubChem CID 6877) has the molecular formula C9H11NO2
and a molecular weight of 165.19 g/mol. Its IUPAC name is ethyl 2-aminobenzoate.
Molecular Properties
| Compound Name | ethyl 2-aminobenzoate |
| PubChem CID | 6877 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | ethyl 2-aminobenzoate |
| SMILES | CCOC(=O)c1ccccc1N |
| InChI | InChI=1S/C9H11NO2/c1-2-12-9(11)7-5-3-4-6-8(7)10/h3-6H,2,10H2,1H3 |
| InChIKey | TWLLPUMZVVGILS-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-aminobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-aminobenzoate?
The IUPAC name of ethyl 2-aminobenzoate (CID 6877) is ethyl 2-aminobenzoate.
What is the SMILES notation for ethyl 2-aminobenzoate?
The canonical SMILES for ethyl 2-aminobenzoate is CCOC(=O)c1ccccc1N.
What is the InChIKey of ethyl 2-aminobenzoate?
The InChIKey is TWLLPUMZVVGILS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2/c1-2-12-9(11)7-5-3-4-6-8(7)10/h3-6H,2,10H2,1H3.
What are the key properties of ethyl 2-aminobenzoate?
ethyl 2-aminobenzoate has a molecular weight of 165.19 g/mol, XLogP of 1.45, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-aminobenzoate is sourced from PubChem (CID 6877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).