About [5-amino-4-(2,4,5-trifluorophenyl)cyclohexen-1-yl]-morpholin-4-ylmethanone
[5-amino-4-(2,4,5-trifluorophenyl)cyclohexen-1-yl]-morpholin-4-ylmethanone (PubChem CID 68770206) has the molecular formula C17H19F3N2O2
and a molecular weight of 340.35 g/mol. Its IUPAC name is [5-amino-4-(2,4,5-trifluorophenyl)cyclohexen-1-yl]-morpholin-4-ylmethanone.
Molecular Properties
| Compound Name | [5-amino-4-(2,4,5-trifluorophenyl)cyclohexen-1-yl]-morpholin-4-ylmethanone |
| PubChem CID | 68770206 |
| Molecular Formula | C17H19F3N2O2 |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | [5-amino-4-(2,4,5-trifluorophenyl)cyclohexen-1-yl]-morpholin-4-ylmethanone |
| SMILES | NC1CC(C(=O)N2CCOCC2)=CCC1c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C17H19F3N2O2/c18-13-9-15(20)14(19)8-12(13)11-2-1-10(7-16(11)21)17(23)22-3-5-24-6-4-22/h1,8-9,11,16H,2-7,21H2 |
| InChIKey | IBMJZDRXFPILND-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze [5-amino-4-(2,4,5-trifluorophenyl)cyclohexen-1-yl]-morpholin-4-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-amino-4-(2,4,5-trifluorophenyl)cyclohexen-1-yl]-morpholin-4-ylmethanone?
The IUPAC name of [5-amino-4-(2,4,5-trifluorophenyl)cyclohexen-1-yl]-morpholin-4-ylmethanone (CID 68770206) is [5-amino-4-(2,4,5-trifluorophenyl)cyclohexen-1-yl]-morpholin-4-ylmethanone.
What is the SMILES notation for [5-amino-4-(2,4,5-trifluorophenyl)cyclohexen-1-yl]-morpholin-4-ylmethanone?
The canonical SMILES for [5-amino-4-(2,4,5-trifluorophenyl)cyclohexen-1-yl]-morpholin-4-ylmethanone is NC1CC(C(=O)N2CCOCC2)=CCC1c1cc(F)c(F)cc1F.
What is the InChIKey of [5-amino-4-(2,4,5-trifluorophenyl)cyclohexen-1-yl]-morpholin-4-ylmethanone?
The InChIKey is IBMJZDRXFPILND-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19F3N2O2/c18-13-9-15(20)14(19)8-12(13)11-2-1-10(7-16(11)21)17(23)22-3-5-24-6-4-22/h1,8-9,11,16H,2-7,21H2.
What are the key properties of [5-amino-4-(2,4,5-trifluorophenyl)cyclohexen-1-yl]-morpholin-4-ylmethanone?
[5-amino-4-(2,4,5-trifluorophenyl)cyclohexen-1-yl]-morpholin-4-ylmethanone has a molecular weight of 340.35 g/mol, XLogP of 2.09, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [5-amino-4-(2,4,5-trifluorophenyl)cyclohexen-1-yl]-morpholin-4-ylmethanone is sourced from PubChem (CID 68770206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).