C27H32N10OSi — CID 68771695
4-[3-[(1S)-2-cyano-1-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]ethyl]pyrrolidin-1-yl]pyrimidine-5-carbonitrile (PubChem CID 68771695) has the molecular formula C27H32N10OSi and a molecular weight of 540.71 g/mol. Its IUPAC name is 4-[3-[(1S)-2-cyano-1-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]ethyl]pyrrolidin-1-yl]pyrimidine-5-carbonitrile.
| Compound Name | 4-[3-[(1S)-2-cyano-1-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]ethyl]pyrrolidin-1-yl]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 68771695 |
| Molecular Formula | C27H32N10OSi |
| Molecular Weight | 540.71 g/mol |
| Exact Mass | 540.25 |
| IUPAC Name | 4-[3-[(1S)-2-cyano-1-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]ethyl]pyrrolidin-1-yl]pyrimidine-5-carbonitrile |
| SMILES | C[Si](C)(C)CCOCn1ccc2c(-c3cnn([C@@H](CC#N)C4CCN(c5ncncc5C#N)C4)c3)ncnc21 |
| InChI | InChI=1S/C27H32N10OSi/c1-39(2,3)11-10-38-19-36-9-6-23-25(31-18-33-27(23)36)22-14-34-37(16-22)24(4-7-28)20-5-8-35(15-20)26-21(12-29)13-30-17-32-26/h6,9,13-14,16-18,20,24H,4-5,8,10-11,15,19H2,1-3H3/t20?,24-/m0/s1 |
| InChIKey | FCXOYUDFNRIMGC-JWIMYKKASA-N |
| XLogP | 4.25 |
| TPSA | 134.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.71 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|